(R)-5-[3-(2-Piperidin-1-yl-ethoxy)-phenyl]-11,12-dihydro-5H-6,13-dioxa-benzo[3,4]cyclohepta[1,2-a]naphthalene-2,8-diol

ID: ALA1087040

PubChem CID: 44596356

Max Phase: Preclinical

Molecular Formula: C30H31NO5

Molecular Weight: 485.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Oc1ccc2c(c1)O[C@H](c1cccc(OCCN3CCCCC3)c1)C1=C2CCOc2cc(O)ccc21

Standard InChI:  InChI=1S/C30H31NO5/c32-21-8-10-26-27(18-21)35-15-11-25-24-9-7-22(33)19-28(24)36-30(29(25)26)20-5-4-6-23(17-20)34-16-14-31-12-2-1-3-13-31/h4-10,17-19,30,32-33H,1-3,11-16H2/t30-/m1/s1

Standard InChI Key:  XGYIXXBEYYYIGU-SSEXGKCCSA-N

Molfile:  

     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
    5.0612  -25.3919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0600  -26.2180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7737  -26.6301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7719  -24.9798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4860  -25.3883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4895  -26.2200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2075  -26.6306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9267  -26.2141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4451  -23.5784    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9241  -25.3872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2007  -24.9672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0728  -24.1036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6225  -23.5173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9368  -24.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7039  -25.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3094  -25.6857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1481  -25.4694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3779  -24.6307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7707  -24.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2191  -24.4100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6409  -26.6243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6391  -27.4481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3526  -27.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0659  -27.4447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0614  -26.6168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3475  -26.2104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3464  -26.6292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7723  -26.2009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4880  -26.6085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1989  -26.1926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9145  -26.6003    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9148  -27.4227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6264  -27.8303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3397  -27.4179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3370  -26.5934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6209  -26.1811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  2  0
  7  8  1  0
 17 18  1  0
  8 10  1  0
 18 19  2  0
 19 14  1  0
  5  4  2  0
 18 20  1  0
  4  1  1  0
  8 21  1  1
  5  6  1  0
 21 22  2  0
 22 23  1  0
  2  3  1  0
 23 24  2  0
 14  9  1  0
 24 25  1  0
 15 10  1  0
 25 26  2  0
 26 21  1  0
 11 12  1  0
  2 27  1  0
 12 13  1  0
 25 28  1  0
 13  9  1  0
 28 29  1  0
 10 11  2  0
 29 30  1  0
  3  6  2  0
 30 31  1  0
 31 32  1  0
  1  2  2  0
 14 15  2  0
  5 11  1  0
 15 16  1  0
  6  7  1  0
 31 36  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
M  END

Associated Targets(Human)

ESR2 Tclin Estrogen receptor beta (9272 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ESR1 Tclin Estrogen receptor alpha (17718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 485.58Molecular Weight (Monoisotopic): 485.2202AlogP: 5.79#Rotatable Bonds: 5
Polar Surface Area: 71.39Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.88CX Basic pKa: 8.40CX LogP: 4.29CX LogD: 3.81
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.48Np Likeness Score: 0.02

References

1. Jain N, Xu J, Kanojia RM, Du F, Jian-Zhong G, Pacia E, Lai MT, Musto A, Allan G, Reuman M, Li X, Hahn D, Cousineau M, Peng S, Ritchie D, Russell R, Lundeen S, Sui Z..  (2009)  Identification and structure-activity relationships of chromene-derived selective estrogen receptor modulators for treatment of postmenopausal symptoms.,  52  (23): [PMID:19366247] [10.1021/jm900146e]

Source