N-(5-fluoro-2-methoxybenzyl)-1-(3-((2-(methylamino)ethylamino)methyl)phenyl)-3-(trifluoromethyl)-1H-pyrazole-5-carboxamide

ID: ALA1087114

PubChem CID: 46880096

Max Phase: Preclinical

Molecular Formula: C23H25F4N5O2

Molecular Weight: 479.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNCCNCc1cccc(-n2nc(C(F)(F)F)cc2C(=O)NCc2cc(F)ccc2OC)c1

Standard InChI:  InChI=1S/C23H25F4N5O2/c1-28-8-9-29-13-15-4-3-5-18(10-15)32-19(12-21(31-32)23(25,26)27)22(33)30-14-16-11-17(24)6-7-20(16)34-2/h3-7,10-12,28-29H,8-9,13-14H2,1-2H3,(H,30,33)

Standard InChI Key:  BWVNEUKPDZHUIO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
   11.6508  -13.3695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6508  -14.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3652  -14.6115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0843  -14.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0843  -13.3695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3652  -12.9524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3589  -12.1254    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.0252  -11.6395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7697  -10.8554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9447  -10.8565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6909  -11.6414    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5151  -10.1519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9107   -9.4280    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.6904  -10.1714    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.1581   -9.4039    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.7394  -12.0524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7391  -12.8774    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4533  -13.2902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1680  -12.8780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4541  -11.6402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.8781  -13.2936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5924  -12.8822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5931  -12.0563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8738  -11.6436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1626  -12.0574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9362  -14.6116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2218  -14.1992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5073  -14.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7928  -14.1993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0784  -14.6119    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3639  -14.1994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8754  -14.1186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1595  -14.5287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8713  -10.8186    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  6  2  0
 16 17  1  0
  2  3  2  0
 17 18  1  0
  3  4  1  0
 18 19  1  0
  8  9  2  0
 16 20  2  0
  9 10  1  0
 19 21  2  0
 10 11  2  0
 21 22  1  0
 11  7  1  0
 22 23  2  0
  6  7  1  0
 23 24  1  0
  4  5  2  0
 24 25  2  0
 25 19  1  0
 10 12  1  0
  2 26  1  0
  5  6  1  0
 26 27  1  0
 12 13  1  0
 27 28  1  0
  7  8  1  0
 28 29  1  0
 12 14  1  0
 29 30  1  0
 30 31  1  0
 12 15  1  0
 21 32  1  0
  1  2  1  0
 32 33  1  0
  8 16  1  0
 24 34  1  0
M  END

Associated Targets(non-human)

Carm1 Histone-arginine methyltransferase CARM1 (53 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 479.48Molecular Weight (Monoisotopic): 479.1944AlogP: 3.28#Rotatable Bonds: 10
Polar Surface Area: 80.21Molecular Species: BASEHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.60CX Basic pKa: 9.61CX LogP: 3.22CX LogD: 1.01
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.31Np Likeness Score: -1.49

References

1. Therrien E, Larouche G, Manku S, Allan M, Nguyen N, Styhler S, Robert MF, Goulet AC, Besterman JM, Nguyen H, Wahhab A..  (2009)  1,2-Diamines as inhibitors of co-activator associated arginine methyltransferase 1 (CARM1).,  19  (23): [PMID:19836951] [10.1016/j.bmcl.2009.09.110]

Source