The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{4-[4-benzoyl-1-(4-chlorophenyl)-1H-pyrazole-3-carbonyl]-1-phenyl-1H-pyrazol-3-yl}-ethanone ID: ALA1087176
PubChem CID: 45277744
Max Phase: Preclinical
Molecular Formula: C28H19ClN4O3
Molecular Weight: 494.94
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)c1nn(-c2ccccc2)cc1C(=O)c1nn(-c2ccc(Cl)cc2)cc1C(=O)c1ccccc1
Standard InChI: InChI=1S/C28H19ClN4O3/c1-18(34)25-23(16-32(30-25)21-10-6-3-7-11-21)28(36)26-24(27(35)19-8-4-2-5-9-19)17-33(31-26)22-14-12-20(29)13-15-22/h2-17H,1H3
Standard InChI Key: ATAJBGDODILWMK-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-2.2748 -0.6960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5924 -0.2215 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8346 0.5717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6639 0.5870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9353 -0.1967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0774 1.3009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6657 2.0161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9027 1.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3117 2.0142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1362 2.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5488 1.2978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1309 0.5812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3077 0.5853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2912 -1.5211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0136 -1.9145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0303 -2.7389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3235 -3.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5982 -2.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5850 -1.9407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1437 1.0200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4087 0.6445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3998 -0.1804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3892 -0.4251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8650 0.2503 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3679 0.9104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8005 -1.1406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3837 -1.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7943 -2.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6205 -2.5690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0344 -1.8502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6215 -1.1380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7589 1.6372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3250 2.3393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1863 1.8442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5839 1.6620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3388 -3.9917 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3 4 1 0
17 18 1 0
8 9 2 0
18 19 2 0
19 14 1 0
4 5 2 0
3 20 1 0
9 10 1 0
20 21 1 0
22 23 1 0
5 1 1 0
10 11 2 0
2 3 2 0
11 12 1 0
21 22 2 0
23 24 1 0
24 25 2 0
25 21 1 0
4 6 1 0
23 26 1 0
12 13 2 0
26 27 2 0
13 8 1 0
27 28 1 0
28 29 2 0
1 14 1 0
29 30 1 0
6 7 2 0
30 31 2 0
31 26 1 0
14 15 2 0
25 32 1 0
1 2 1 0
32 33 2 0
15 16 1 0
20 34 2 0
6 8 1 0
32 35 1 0
16 17 2 0
17 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.94Molecular Weight (Monoisotopic): 494.1146AlogP: 5.38#Rotatable Bonds: 7Polar Surface Area: 86.85Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.00CX LogD: 6.00Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.28Np Likeness Score: -0.91
References 1. Riyadh SM, Farghaly TA, Abdallah MA, Abdalla MM, Abd El-Aziz MR.. (2010) New pyrazoles incorporating pyrazolylpyrazole moiety: synthesis, anti-HCV and antitumor activity., 45 (3): [PMID:20022411 ] [10.1016/j.ejmech.2009.11.050 ]