The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-(3-(4-aminophenyl)acryloyl)piperazin-1-yl)-6,6-diphenylhexan-1-one ID: ALA1087237
PubChem CID: 12972309
Max Phase: Preclinical
Molecular Formula: C31H35N3O2
Molecular Weight: 481.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ccc(/C=C/C(=O)N2CCN(C(=O)CCCCC(c3ccccc3)c3ccccc3)CC2)cc1
Standard InChI: InChI=1S/C31H35N3O2/c32-28-18-15-25(16-19-28)17-20-31(36)34-23-21-33(22-24-34)30(35)14-8-7-13-29(26-9-3-1-4-10-26)27-11-5-2-6-12-27/h1-6,9-12,15-20,29H,7-8,13-14,21-24,32H2/b20-17+
Standard InChI Key: SGBSGHFCOPKJPE-LVZFUZTISA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
14.3695 -25.2504 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3695 -26.0759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0825 -26.4866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7914 -26.0759 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7914 -25.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0825 -24.8355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6529 -24.8418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9386 -25.2545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5063 -26.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2223 -26.0779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9371 -26.4937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6533 -26.0800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3681 -26.4958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0842 -26.0821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7990 -26.4979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0854 -25.2565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8017 -24.8494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8033 -24.0247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0879 -23.6079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3695 -24.0262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3714 -24.8495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7953 -27.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5052 -27.7372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2222 -27.3233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2208 -26.4935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5062 -26.0816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5051 -27.3172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2219 -24.8460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5077 -25.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7918 -24.8467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0779 -25.2588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0799 -26.0894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8016 -26.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5125 -26.0793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6505 -24.0162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3709 -26.5040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17 18 1 0
4 9 1 0
18 19 2 0
2 3 1 0
19 20 1 0
9 10 1 0
20 21 2 0
21 16 1 0
3 4 1 0
15 22 2 0
10 11 1 0
22 23 1 0
4 5 1 0
23 24 2 0
11 12 1 0
24 25 1 0
5 6 1 0
25 26 2 0
26 15 1 0
12 13 1 0
9 27 2 0
8 28 2 0
13 14 1 0
28 29 1 0
1 7 1 0
29 30 2 0
14 15 1 0
30 31 1 0
1 2 1 0
31 32 2 0
14 16 1 0
32 33 1 0
7 8 1 0
33 34 2 0
34 29 1 0
16 17 2 0
7 35 2 0
1 6 1 0
32 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.64Molecular Weight (Monoisotopic): 481.2729AlogP: 5.35#Rotatable Bonds: 9Polar Surface Area: 66.64Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.01CX LogP: 5.06CX LogD: 5.05Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.25Np Likeness Score: -0.27
References 1. Zamponi GW, Feng ZP, Zhang L, Pajouhesh H, Ding Y, Belardetti F, Pajouhesh H, Dolphin D, Mitscher LA, Snutch TP.. (2009) Scaffold-based design and synthesis of potent N-type calcium channel blockers., 19 (22): [PMID:19815411 ] [10.1016/j.bmcl.2009.09.008 ]