The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((2,3-dihydrobenzo[b][1,4]dioxin-5-yl)methyl)-1-(3-((2-(methylamino)ethylamino)methyl)phenyl)-3-(trifluoromethyl)-1H-pyrazole-5-carboxamide ID: ALA1087540
PubChem CID: 46880095
Max Phase: Preclinical
Molecular Formula: C24H26F3N5O3
Molecular Weight: 489.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CNCCNCc1cccc(-n2nc(C(F)(F)F)cc2C(=O)NCc2cccc3c2OCCO3)c1
Standard InChI: InChI=1S/C24H26F3N5O3/c1-28-8-9-29-14-16-4-2-6-18(12-16)32-19(13-21(31-32)24(25,26)27)23(33)30-15-17-5-3-7-20-22(17)35-11-10-34-20/h2-7,12-13,28-29H,8-11,14-15H2,1H3,(H,30,33)
Standard InChI Key: CVJPIIHCIDASSV-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-0.6416 -12.8653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6416 -13.6949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0728 -14.1074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7919 -13.6949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7919 -12.8653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0728 -12.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0665 -11.6213 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7328 -11.1354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4773 -10.3511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3477 -10.3523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6015 -11.1373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7773 -9.6478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3817 -8.9238 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.6020 -9.6673 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.1343 -8.8997 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.4470 -11.5482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4467 -12.3732 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1609 -12.7861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8756 -12.3739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1617 -11.1361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3007 -11.5521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5815 -11.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8702 -11.5533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3562 -14.1075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0706 -13.6951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7851 -14.1076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4996 -13.6952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2140 -14.1077 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9285 -13.6953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3000 -12.3780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5867 -12.7871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5844 -13.6047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2936 -14.0194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0067 -13.6104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0108 -12.7866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16 17 1 0
2 3 2 0
17 18 1 0
3 4 1 0
18 19 1 0
8 9 2 0
16 20 2 0
19 31 2 0
9 10 1 0
30 21 2 0
10 11 2 0
21 22 1 0
11 7 1 0
22 23 2 0
23 19 1 0
6 7 1 0
2 24 1 0
4 5 2 0
24 25 1 0
10 12 1 0
25 26 1 0
5 6 1 0
26 27 1 0
12 13 1 0
27 28 1 0
7 8 1 0
28 29 1 0
30 31 1 0
12 14 1 0
12 15 1 0
1 2 1 0
8 16 1 0
1 6 2 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.50Molecular Weight (Monoisotopic): 489.1988AlogP: 2.90#Rotatable Bonds: 9Polar Surface Area: 89.44Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.62CX Basic pKa: 9.61CX LogP: 2.75CX LogD: 0.54Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: -1.32
References 1. Therrien E, Larouche G, Manku S, Allan M, Nguyen N, Styhler S, Robert MF, Goulet AC, Besterman JM, Nguyen H, Wahhab A.. (2009) 1,2-Diamines as inhibitors of co-activator associated arginine methyltransferase 1 (CARM1)., 19 (23): [PMID:19836951 ] [10.1016/j.bmcl.2009.09.110 ]