The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-5-[4-(3-Piperidin-1-yl-propoxy)-phenyl]-11,12-dihydro-5H-6,13-dioxa-benzo[3,4]cyclohepta[1,2-a]naphthalene-2,8-diol ID: ALA1087546
PubChem CID: 44596355
Max Phase: Preclinical
Molecular Formula: C31H33NO5
Molecular Weight: 499.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Oc1ccc2c(c1)O[C@H](c1ccc(OCCCN3CCCCC3)cc1)C1=C2CCOc2cc(O)ccc21
Standard InChI: InChI=1S/C31H33NO5/c33-22-8-12-27-28(19-22)36-18-13-26-25-11-7-23(34)20-29(25)37-31(30(26)27)21-5-9-24(10-6-21)35-17-4-16-32-14-2-1-3-15-32/h5-12,19-20,31,33-34H,1-4,13-18H2/t31-/m1/s1
Standard InChI Key: YLXFTHBZFPHABL-WJOKGBTCSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
15.9656 -19.1538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9645 -19.9800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6782 -20.3921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6764 -18.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3907 -19.1502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3941 -19.9819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1122 -20.3926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8315 -19.9761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3499 -17.3401 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8289 -19.1491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1053 -18.7291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9774 -17.8654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5272 -17.2790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8417 -17.9962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6087 -18.8307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2143 -19.4477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0530 -19.2313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2828 -18.3925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6757 -17.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1242 -18.1718 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.5457 -20.3863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5440 -21.2102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2574 -21.6203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9708 -21.2068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9663 -20.3788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2523 -19.9724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6857 -21.6161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3976 -21.2018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2508 -20.3912 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1124 -21.6110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8243 -21.1967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5391 -21.6060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5380 -22.4288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2487 -22.8381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9630 -22.4271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9621 -21.6025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2468 -21.1887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7 8 1 0
17 18 1 0
8 10 1 0
18 19 2 0
19 14 1 0
5 4 2 0
18 20 1 0
4 1 1 0
8 21 1 1
5 6 1 0
21 22 2 0
22 23 1 0
2 3 1 0
23 24 2 0
14 9 1 0
24 25 1 0
15 10 1 0
25 26 2 0
26 21 1 0
11 12 1 0
24 27 1 0
12 13 1 0
27 28 1 0
13 9 1 0
2 29 1 0
10 11 2 0
28 30 1 0
3 6 2 0
30 31 1 0
1 2 2 0
31 32 1 0
32 33 1 0
14 15 2 0
5 11 1 0
15 16 1 0
6 7 1 0
16 17 2 0
32 37 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.61Molecular Weight (Monoisotopic): 499.2359AlogP: 6.18#Rotatable Bonds: 6Polar Surface Area: 71.39Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.52CX Basic pKa: 9.54CX LogP: 4.24CX LogD: 3.49Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.39Np Likeness Score: 0.07
References 1. Jain N, Xu J, Kanojia RM, Du F, Jian-Zhong G, Pacia E, Lai MT, Musto A, Allan G, Reuman M, Li X, Hahn D, Cousineau M, Peng S, Ritchie D, Russell R, Lundeen S, Sui Z.. (2009) Identification and structure-activity relationships of chromene-derived selective estrogen receptor modulators for treatment of postmenopausal symptoms., 52 (23): [PMID:19366247 ] [10.1021/jm900146e ]