The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(2,4-Dihydroxyphenyl)-4-methyl-2-(3-methyl-5-oxo-4-(thiophen-2-ylmethylene)-4,5-dihydro-1H-pyrazol-1-yl)-N-(3-nitrophenyl)-1,6-dihydropyrimidine-5-carboxamide ID: ALA1087566
PubChem CID: 45276458
Max Phase: Preclinical
Molecular Formula: C27H22N6O6S
Molecular Weight: 558.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1=NN(C2=NC(C)=C(C(=O)Nc3cccc([N+](=O)[O-])c3)C(c3ccc(O)cc3O)N2)C(=O)/C1=C/c1cccs1
Standard InChI: InChI=1S/C27H22N6O6S/c1-14-21(13-19-7-4-10-40-19)26(37)32(31-14)27-28-15(2)23(24(30-27)20-9-8-18(34)12-22(20)35)25(36)29-16-5-3-6-17(11-16)33(38)39/h3-13,24,34-35H,1-2H3,(H,28,30)(H,29,36)/b21-13+
Standard InChI Key: CTYXIXSMACYNBZ-FYJGNVAPSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
6.8206 -15.3529 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0206 -15.1363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5673 -15.8302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0872 -16.4758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8617 -16.1807 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5402 -11.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5391 -12.4732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2539 -12.8860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9703 -12.4727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9675 -11.6422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2521 -11.2330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2556 -13.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5394 -14.1206 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5388 -14.9448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2537 -15.3583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9707 -14.9415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9677 -14.1187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2496 -10.4080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8243 -12.8851 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6865 -15.3517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6811 -13.7044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3966 -14.1151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6791 -12.8794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1101 -13.7008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8236 -14.1156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5365 -13.7020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5349 -12.8761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8144 -12.4656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1044 -12.8815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8100 -11.6371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0931 -11.2289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5220 -11.2203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7270 -14.3653 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8715 -17.2721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7433 -15.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3668 -16.6051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5473 -16.7337 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.4161 -17.5482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1502 -17.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7350 -17.3429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 10 1 0
16 20 1 0
5 1 1 0
17 21 1 0
10 11 2 0
21 22 1 0
11 6 1 0
21 23 2 0
1 2 1 0
22 24 1 0
24 25 2 0
12 13 1 0
25 26 1 0
6 7 2 0
26 27 2 0
13 14 1 0
27 28 1 0
2 3 1 0
28 29 2 0
29 24 1 0
14 15 2 0
7 8 1 0
15 16 1 0
30 31 2 0
30 32 1 0
28 30 1 0
14 1 1 0
3 4 1 0
2 33 2 0
16 17 2 0
4 34 1 0
17 12 1 0
3 35 2 0
8 12 1 0
35 36 1 0
36 37 1 0
8 9 2 0
11 18 1 0
4 5 2 0
7 19 1 0
37 38 1 0
38 39 2 0
39 40 1 0
40 36 2 0
M CHG 2 30 1 32 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 558.58Molecular Weight (Monoisotopic): 558.1322AlogP: 4.28#Rotatable Bonds: 5Polar Surface Area: 169.76Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.63CX Basic pKa: 0.82CX LogP: 4.03CX LogD: 4.00Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.21Np Likeness Score: -1.42
References 1. Ibrahim DA, El-Metwally AM.. (2010) Design, synthesis, and biological evaluation of novel pyrimidine derivatives as CDK2 inhibitors., 45 (3): [PMID:20045222 ] [10.1016/j.ejmech.2009.12.026 ]