1-(4-cinnamylpiperazin-1-yl)-6,6-bis(4-fluorophenyl)hexan-1-one

ID: ALA1087660

PubChem CID: 46880111

Max Phase: Preclinical

Molecular Formula: C31H34F2N2O

Molecular Weight: 488.62

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CCCCC(c1ccc(F)cc1)c1ccc(F)cc1)N1CCN(C/C=C/c2ccccc2)CC1

Standard InChI:  InChI=1S/C31H34F2N2O/c32-28-16-12-26(13-17-28)30(27-14-18-29(33)19-15-27)10-4-5-11-31(36)35-23-21-34(22-24-35)20-6-9-25-7-2-1-3-8-25/h1-3,6-9,12-19,30H,4-5,10-11,20-24H2/b9-6+

Standard InChI Key:  HQRVILVXQIGODC-RMKNXTFCSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   -3.0512  -14.7706    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0512  -15.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3386  -16.0018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6260  -15.5956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6260  -14.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3386  -14.3519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7631  -14.3582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4770  -14.7748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9117  -16.0070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1960  -15.5977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5184  -16.0091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2340  -15.5997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9442  -16.0112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6599  -15.6018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3742  -16.0133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6611  -14.7769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3769  -14.3658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3785  -13.5416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6635  -13.1294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9456  -13.5432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9475  -14.3660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3705  -16.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0841  -17.2517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8007  -16.8382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7993  -16.0089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0851  -15.6013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9129  -16.8320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1932  -14.3623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9069  -14.7790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6268  -14.3632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3395  -14.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3415  -15.6050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6200  -16.0131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9023  -15.5990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6636  -12.3044    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.5156  -17.2528    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
 17 18  1  0
  4  9  1  0
 18 19  2  0
  2  3  1  0
 19 20  1  0
  9 10  1  0
 20 21  2  0
 21 16  1  0
  3  4  1  0
 15 22  2  0
 10 11  1  0
 22 23  1  0
  4  5  1  0
 23 24  2  0
 11 12  1  0
 24 25  1  0
  5  6  1  0
 25 26  2  0
 26 15  1  0
 12 13  1  0
  9 27  2  0
  8 28  2  0
 13 14  1  0
 28 29  1  0
  1  7  1  0
 29 30  2  0
 14 15  1  0
 30 31  1  0
  1  2  1  0
 31 32  2  0
 14 16  1  0
 32 33  1  0
  7  8  1  0
 33 34  2  0
 34 29  1  0
 16 17  2  0
 19 35  1  0
  1  6  1  0
 24 36  1  0
M  END

Associated Targets(non-human)

Cacna2d1 Voltage-dependent L-type calcium channel subunit beta-1/alpha-1B/alpha-2/delta-1 (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 488.62Molecular Weight (Monoisotopic): 488.2639AlogP: 6.51#Rotatable Bonds: 10
Polar Surface Area: 23.55Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.57CX LogP: 6.92CX LogD: 6.86
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.30Np Likeness Score: -0.70

References

1. Zamponi GW, Feng ZP, Zhang L, Pajouhesh H, Ding Y, Belardetti F, Pajouhesh H, Dolphin D, Mitscher LA, Snutch TP..  (2009)  Scaffold-based design and synthesis of potent N-type calcium channel blockers.,  19  (22): [PMID:19815411] [10.1016/j.bmcl.2009.09.008]

Source