betulin-28-oxime

ID: ALA1087753

Cas Number: 25613-12-1

PubChem CID: 12043480

Max Phase: Preclinical

Molecular Formula: C30H49NO2

Molecular Weight: 455.73

Molecule Type: Small molecule

Names and Identifiers

Synonyms: Betulin-28-Oxime | betulin-28-oxime|25613-12-1|CHEMBL1087753|3beta-hydroxy-lup-20(29)-en-28-al oxime|(1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-3a-[(E)-hydroxyiminomethyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol|BDBM50601889

Canonical SMILES:  C=C(C)[C@@H]1CC[C@]2(/C=N/O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12

Standard InChI:  InChI=1S/C30H49NO2/c1-19(2)20-10-15-30(18-31-33)17-16-28(6)21(25(20)30)8-9-23-27(5)13-12-24(32)26(3,4)22(27)11-14-29(23,28)7/h18,20-25,32-33H,1,8-17H2,2-7H3/b31-18+/t20-,21+,22-,23+,24-,25+,27-,28+,29+,30+/m0/s1

Standard InChI Key:  GCYZHONUJBNDJH-UXEVJXGNSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   15.8532  -11.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8532  -12.1611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5656  -12.5736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5656  -10.9185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2779  -11.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2788  -12.1611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9872  -12.5745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7054  -12.1684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9957  -10.9194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7050  -11.3415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7205   -9.6910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9972  -10.0978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4348  -10.1130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4179  -10.9385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1211  -11.3605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8417  -10.9627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1499   -9.7147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8532  -10.1367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4737   -9.5999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1573   -8.8451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3380   -8.9134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2740  -10.5060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6949  -10.5162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4129  -11.7587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5621  -10.5468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7966   -8.2874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0673   -7.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9843   -8.4404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1435  -13.2865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9685  -13.2865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2690  -12.9861    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.9871  -11.7486    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   20.1412  -10.5417    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.4282   -9.2787    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   22.2812  -10.1323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.9998  -10.5480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1340  -12.5757    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 17 18  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  3  6  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 17  1  0
  5  4  1  0
  5 22  1  1
  5  6  1  0
 10 23  1  1
 14 24  1  6
  9 12  1  0
 18 25  1  1
 10 14  1  0
 21 26  1  6
 13 11  1  0
 26 27  2  0
 11 12  1  0
 26 28  1  0
 13 14  1  0
  3 29  1  0
  1  2  1  0
  3 30  1  0
  1  4  1  0
  6 31  1  6
  2  3  1  0
  9 32  1  6
  5  9  1  0
 17 33  1  6
 13 17  1  0
 13 34  1  1
 14 15  1  0
 25 35  2  0
 15 16  1  0
 35 36  1  0
 16 18  1  0
  2 37  1  1
M  END

Alternative Forms

1. Parent:

   

   ALA1087753

   Betulin-28-oxime

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 455.73

Molecular Weight (Monoisotopic): 455.3763

AlogP: 7.46

#Rotatable Bonds: 2

Polar Surface Area: 52.82

Molecular Species: NEUTRAL

HBA: 3

HBD: 2

#RO5 Violations: 1

HBA (Lipinski): 3

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 10.31

CX Basic pKa: 3.05

CX LogP: 6.49

CX LogD: 6.49

Aromatic Rings: ┄

Heavy Atoms: 33

QED Weighted: 0.20

Np Likeness Score: 3.00

References

1. Pohjala L, Alakurtti S, Ahola T, Yli-Kauhaluoma J, Tammela P..  (2009)  Betulin-derived compounds as inhibitors of alphavirus replication.,  72  (11): [PMID:19839605] [10.1021/np9003245]

2. Alcazar W, López AS, Alakurtti S, Tuononen ML, Yli-Kauhaluoma J, Ponte-Sucre A..  (2014)  Betulin derivatives impair Leishmania braziliensis viability and host-parasite interaction.,  22  (21): [PMID:25240731] [10.1016/j.bmc.2014.08.023]

3. Laavola M, Haavikko R, Hämäläinen M, Leppänen T, Nieminen R, Alakurtti S, Moreira VM, Yli-Kauhaluoma J, Moilanen E..  (2016)  Betulin Derivatives Effectively Suppress Inflammation in Vitro and in Vivo.,  79  (2): [PMID:26915998] [10.1021/acs.jnatprod.5b00709]

4. Chen S, Zhang L, Chen Y, Fu L..  (2022)  Inhibiting Sodium Taurocholate Cotransporting Polypeptide in HBV-Related Diseases: From Biological Function to Therapeutic Potential.,  65  (19.0): [PMID:36111355] [10.1021/acs.jmedchem.2c01097]

Source

Source(1):

• Scientific Literature