The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-(3-(4-methoxyphenyl)allyl)piperazin-1-yl)-6,6-diphenylhexan-1-one ID: ALA1087779
PubChem CID: 46880112
Max Phase: Preclinical
Molecular Formula: C32H38N2O2
Molecular Weight: 482.67
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C/CN2CCN(C(=O)CCCCC(c3ccccc3)c3ccccc3)CC2)cc1
Standard InChI: InChI=1S/C32H38N2O2/c1-36-30-20-18-27(19-21-30)11-10-22-33-23-25-34(26-24-33)32(35)17-9-8-16-31(28-12-4-2-5-13-28)29-14-6-3-7-15-29/h2-7,10-15,18-21,31H,8-9,16-17,22-26H2,1H3/b11-10+
Standard InChI Key: WAGKNCTULDCRRT-ZHACJKMWSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
21.0829 -13.7856 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0829 -14.6112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7960 -15.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5049 -14.6112 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.5049 -13.7856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7960 -13.3708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3662 -13.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6519 -13.7898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2198 -15.0271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9359 -14.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6508 -15.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3670 -14.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0819 -15.0312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7979 -14.6173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5129 -15.0332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7991 -13.7919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5156 -13.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5171 -12.5598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8016 -12.1432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0832 -12.5613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0851 -13.3848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5092 -15.8568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2191 -16.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9362 -15.8587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9348 -15.0289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2201 -14.6168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2186 -15.8526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9352 -13.3811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2209 -13.7939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5048 -13.3820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7910 -13.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7930 -14.6247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5147 -15.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2256 -14.6146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0834 -15.0384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3662 -14.6308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17 18 1 0
4 9 1 0
18 19 2 0
2 3 1 0
19 20 1 0
9 10 1 0
20 21 2 0
21 16 1 0
3 4 1 0
15 22 2 0
10 11 1 0
22 23 1 0
4 5 1 0
23 24 2 0
11 12 1 0
24 25 1 0
5 6 1 0
25 26 2 0
26 15 1 0
12 13 1 0
9 27 2 0
8 28 2 0
13 14 1 0
28 29 1 0
1 7 1 0
29 30 2 0
14 15 1 0
30 31 1 0
1 2 1 0
31 32 2 0
14 16 1 0
32 33 1 0
7 8 1 0
33 34 2 0
34 29 1 0
16 17 2 0
32 35 1 0
1 6 1 0
35 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.67Molecular Weight (Monoisotopic): 482.2933AlogP: 6.25#Rotatable Bonds: 11Polar Surface Area: 32.78Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.50CX LogP: 6.47CX LogD: 6.42Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.30Np Likeness Score: -0.49
References 1. Zamponi GW, Feng ZP, Zhang L, Pajouhesh H, Ding Y, Belardetti F, Pajouhesh H, Dolphin D, Mitscher LA, Snutch TP.. (2009) Scaffold-based design and synthesis of potent N-type calcium channel blockers., 19 (22): [PMID:19815411 ] [10.1016/j.bmcl.2009.09.008 ]