2,2,2-trifluoro-N-((8-mesityl-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidin-3-yl)methyl)-N-phenethylethanamine

ID: ALA1087803

PubChem CID: 21916214

Max Phase: Preclinical

Molecular Formula: C27H30F6N4

Molecular Weight: 524.55

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(C)c(N2CCCn3c2nc(C(F)(F)F)c3CN(CCc2ccccc2)CC(F)(F)F)c(C)c1

Standard InChI:  InChI=1S/C27H30F6N4/c1-18-14-19(2)23(20(3)15-18)37-12-7-11-36-22(24(27(31,32)33)34-25(36)37)16-35(17-26(28,29)30)13-10-21-8-5-4-6-9-21/h4-6,8-9,14-15H,7,10-13,16-17H2,1-3H3

Standard InChI Key:  VBKRICBNLHQYSB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   17.6024  -24.5752    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3223  -24.1810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3387  -23.3562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6350  -22.9255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1093  -24.3955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8986  -24.1529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9106  -23.3265    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1276  -23.0612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6346  -23.7242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9247  -22.2616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1611  -21.9496    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5861  -25.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8615  -25.7968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8449  -26.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5516  -27.0483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2765  -26.6456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2896  -25.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0109  -25.4223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1560  -25.3691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5364  -27.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7379  -22.6571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9130  -22.6444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8096  -23.7144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4057  -22.9950    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.3886  -24.4239    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.9821  -23.6951    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.1218  -21.1261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8157  -20.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5116  -21.9236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9358  -21.2180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5351  -20.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7093  -20.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2859  -21.1976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6890  -21.9149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7764  -19.8559    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.5491  -21.0579    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.5250  -20.2625    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  7  8  1  0
 17 18  1  0
  8  9  2  0
 13 19  1  0
  9  5  1  0
 15 20  1  0
  3  4  1  0
 11 21  1  0
  8 10  1  0
 21 22  1  0
  6  7  1  0
  9 23  1  0
 10 11  1  0
 23 24  1  0
 23 25  1  0
  1 12  1  0
 23 26  1  0
  7  4  1  0
 11 27  1  0
 12 13  2  0
 27 28  1  0
  6  1  1  0
 22 29  1  0
 13 14  1  0
 29 30  2  0
  1  2  1  0
 30 31  1  0
 14 15  2  0
 31 32  2  0
  2  3  1  0
 32 33  1  0
 15 16  1  0
 33 34  2  0
 34 29  1  0
  5  6  2  0
 28 35  1  0
 16 17  2  0
 28 36  1  0
 17 12  1  0
 28 37  1  0
M  END

Associated Targets(Human)

CRHR1 Tclin Corticotropin releasing factor receptor 1 (2996 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 524.55Molecular Weight (Monoisotopic): 524.2375AlogP: 6.98#Rotatable Bonds: 7
Polar Surface Area: 24.30Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 4.12CX LogP: 7.95CX LogD: 7.95
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: -1.29

References

1. Vrudhula VM, Dasgupta B, Pin SS, Burris KD, Balanda LA, Fung LK, Fiedler T, Browman KE, Taber MT, Zhang J, Macor JE, Dubowchik GM..  (2010)  Design, synthesis and evaluation of constrained tetrahydroimidazopyrimidine derivatives as antagonists of corticotropin-releasing factor type 1 receptor (CRF1R).,  20  (6): [PMID:20185312] [10.1016/j.bmcl.2010.01.127]

Source