The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-4-(2,4-dichloro-5-methoxyphenylamino)-7-(4-morpholinobut-1-enyl)quinoline-3-carbonitrile ID: ALA1088121
PubChem CID: 46889033
Max Phase: Preclinical
Molecular Formula: C25H24Cl2N4O2
Molecular Weight: 483.40
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(Nc2c(C#N)cnc3cc(/C=C/CCN4CCOCC4)ccc23)c(Cl)cc1Cl
Standard InChI: InChI=1S/C25H24Cl2N4O2/c1-32-24-14-23(20(26)13-21(24)27)30-25-18(15-28)16-29-22-12-17(5-6-19(22)25)4-2-3-7-31-8-10-33-11-9-31/h2,4-6,12-14,16H,3,7-11H2,1H3,(H,29,30)/b4-2+
Standard InChI Key: SVAFKXHQTWXBPF-DUXPYHPUSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
0.1487 -2.2267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1388 -1.4045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5774 -1.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2848 -1.4204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2774 -2.2454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5625 -2.6533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2743 -0.4714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9847 -0.0520 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2872 -1.7907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0071 -2.1928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7176 -1.7755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4446 -2.1784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4069 -0.5280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7057 -0.9610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1367 -0.9282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1529 -1.7548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8715 -2.1473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5745 -1.7270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5617 -0.8929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8315 -0.5015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5394 0.7381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2567 0.3396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9730 0.7558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9635 1.5809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2400 1.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5277 1.5544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8077 1.9669 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.6929 0.3475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4016 0.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6782 2.0023 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.5794 -2.2089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8589 -1.8072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8262 0.3235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5 6 1 0
1 2 1 0
1 6 1 0
2 3 1 0
7 8 3 0
9 10 2 0
10 11 1 0
11 12 2 0
12 16 1 0
15 13 1 0
13 14 2 0
14 11 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 15 2 0
19 7 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
26 27 1 0
23 28 1 0
28 29 1 0
24 30 1 0
9 31 1 0
3 4 1 0
31 32 1 0
32 1 1 0
4 5 1 0
20 33 1 0
33 21 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.40Molecular Weight (Monoisotopic): 482.1276AlogP: 5.90#Rotatable Bonds: 7Polar Surface Area: 70.41Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.49CX LogP: 5.10CX LogD: 4.75Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.45Np Likeness Score: -1.11
References 1. Boschelli DH, Wang D, Wang Y, Wu B, Honores EE, Barrios Sosa AC, Chaudhary I, Golas J, Lucas J, Boschelli F.. (2010) Optimization of 7-alkene-3-quinolinecarbonitriles as Src kinase inhibitors., 20 (9): [PMID:20363128 ] [10.1016/j.bmcl.2010.03.025 ]