6,6-bis(4-fluorophenyl)-1-(4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl)hexan-1-one

ID: ALA1088174

PubChem CID: 46880086

Max Phase: Preclinical

Molecular Formula: C32H36F2N2O5

Molecular Weight: 566.65

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(C(=O)N2CCN(C(=O)CCCCC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc(OC)c1OC

Standard InChI:  InChI=1S/C32H36F2N2O5/c1-39-28-20-24(21-29(40-2)31(28)41-3)32(38)36-18-16-35(17-19-36)30(37)7-5-4-6-27(22-8-12-25(33)13-9-22)23-10-14-26(34)15-11-23/h8-15,20-21,27H,4-7,16-19H2,1-3H3

Standard InChI Key:  LNUFLBXUQBLZHK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 41 44  0  0  0  0  0  0  0  0999 V2000
   12.3447   -4.7662    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3447   -5.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0577   -5.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7708   -5.5917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7708   -4.7662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0577   -4.3472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6322   -4.3534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9180   -4.7703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2019   -4.3545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4882   -4.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4902   -5.5970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2118   -6.0054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9226   -5.5911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2172   -6.8309    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5044   -7.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7765   -6.0107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0602   -5.6031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7718   -4.3576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7697   -3.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4856   -6.0033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2015   -5.5937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9164   -6.0054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6324   -5.5957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3432   -6.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0592   -5.5978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7741   -6.0095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0603   -4.7723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7767   -4.3611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7782   -3.5364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0628   -3.1238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3445   -3.5379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3464   -4.3613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7704   -6.8330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4844   -7.2487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2014   -6.8349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1999   -6.0052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4853   -5.5973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0629   -2.2984    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   20.9168   -7.2498    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.4844   -6.8288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6309   -3.5284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  4 20  1  0
  9 10  1  0
 20 21  1  0
  3  4  1  0
 21 22  1  0
 10 11  2  0
 22 23  1  0
  4  5  1  0
 23 24  1  0
 11 12  1  0
 24 25  1  0
  5  6  1  0
 25 26  1  0
 12 13  2  0
 25 27  1  0
 13  8  1  0
 27 28  2  0
 28 29  1  0
 12 14  1  0
 29 30  2  0
  1  7  1  0
 30 31  1  0
 14 15  1  0
 31 32  2  0
 32 27  1  0
  1  2  1  0
 26 33  2  0
 11 16  1  0
 33 34  1  0
  7  8  1  0
 34 35  2  0
 16 17  1  0
 35 36  1  0
  1  6  1  0
 36 37  2  0
 37 26  1  0
 10 18  1  0
 30 38  1  0
  8  9  2  0
 35 39  1  0
 18 19  1  0
 20 40  2  0
  7 41  2  0
M  END

Associated Targets(non-human)

Cacna2d1 Voltage-dependent L-type calcium channel subunit beta-1/alpha-1B/alpha-2/delta-1 (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 566.65Molecular Weight (Monoisotopic): 566.2592AlogP: 5.67#Rotatable Bonds: 11
Polar Surface Area: 68.31Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 5.19CX LogD: 5.19
Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.28Np Likeness Score: -0.60

References

1. Zamponi GW, Feng ZP, Zhang L, Pajouhesh H, Ding Y, Belardetti F, Pajouhesh H, Dolphin D, Mitscher LA, Snutch TP..  (2009)  Scaffold-based design and synthesis of potent N-type calcium channel blockers.,  19  (22): [PMID:19815411] [10.1016/j.bmcl.2009.09.008]

Source