The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-ethylbenzyl)-1-(3-((2-(methylamino)ethylamino)methyl)phenyl)-3-(trifluoromethyl)-1H-pyrazole-5-carboxamide ID: ALA1088188
PubChem CID: 46880043
Max Phase: Preclinical
Molecular Formula: C24H28F3N5O
Molecular Weight: 459.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccccc1CNC(=O)c1cc(C(F)(F)F)nn1-c1cccc(CNCCNC)c1
Standard InChI: InChI=1S/C24H28F3N5O/c1-3-18-8-4-5-9-19(18)16-30-23(33)21-14-22(24(25,26)27)31-32(21)20-10-6-7-17(13-20)15-29-12-11-28-2/h4-10,13-14,28-29H,3,11-12,15-16H2,1-2H3,(H,30,33)
Standard InChI Key: SPSXISCCCWERLI-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
-0.4125 -6.2287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4125 -7.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3019 -7.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0210 -7.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0210 -6.2287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3019 -5.8115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2958 -4.9847 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9619 -4.4987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7064 -3.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1186 -3.7156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3723 -4.5007 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5481 -3.0112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1526 -2.2872 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.3729 -3.0307 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.9052 -2.2631 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.6762 -4.9115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6758 -5.7365 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3900 -6.1493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1047 -5.7372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3908 -4.4994 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8150 -6.1529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5291 -5.7414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5300 -4.9155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8106 -4.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0994 -4.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1269 -7.4709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8415 -7.0584 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5559 -7.4710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2704 -7.0585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9848 -7.4711 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.6993 -7.0587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8121 -6.9779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0962 -7.3879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8 16 1 0
1 6 2 0
16 17 1 0
2 3 2 0
17 18 1 0
3 4 1 0
18 19 1 0
8 9 2 0
16 20 2 0
9 10 1 0
19 21 2 0
10 11 2 0
21 22 1 0
11 7 1 0
22 23 2 0
6 7 1 0
23 24 1 0
4 5 2 0
24 25 2 0
25 19 1 0
10 12 1 0
2 26 1 0
5 6 1 0
26 27 1 0
12 13 1 0
27 28 1 0
7 8 1 0
28 29 1 0
12 14 1 0
29 30 1 0
30 31 1 0
12 15 1 0
21 32 1 0
1 2 1 0
32 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.52Molecular Weight (Monoisotopic): 459.2246AlogP: 3.69#Rotatable Bonds: 10Polar Surface Area: 70.98Molecular Species: BASEHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.70CX Basic pKa: 9.61CX LogP: 4.19CX LogD: 1.98Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.40Np Likeness Score: -1.32
References 1. Therrien E, Larouche G, Manku S, Allan M, Nguyen N, Styhler S, Robert MF, Goulet AC, Besterman JM, Nguyen H, Wahhab A.. (2009) 1,2-Diamines as inhibitors of co-activator associated arginine methyltransferase 1 (CARM1)., 19 (23): [PMID:19836951 ] [10.1016/j.bmcl.2009.09.110 ]