N-(2-ethylbenzyl)-1-(3-((2-(methylamino)ethylamino)methyl)phenyl)-3-(trifluoromethyl)-1H-pyrazole-5-carboxamide

ID: ALA1088188

PubChem CID: 46880043

Max Phase: Preclinical

Molecular Formula: C24H28F3N5O

Molecular Weight: 459.52

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCc1ccccc1CNC(=O)c1cc(C(F)(F)F)nn1-c1cccc(CNCCNC)c1

Standard InChI:  InChI=1S/C24H28F3N5O/c1-3-18-8-4-5-9-19(18)16-30-23(33)21-14-22(24(25,26)27)31-32(21)20-10-6-7-17(13-20)15-29-12-11-28-2/h4-10,13-14,28-29H,3,11-12,15-16H2,1-2H3,(H,30,33)

Standard InChI Key:  SPSXISCCCWERLI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   -0.4125   -6.2287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4125   -7.0583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3019   -7.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0210   -7.0583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0210   -6.2287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3019   -5.8115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2958   -4.9847    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9619   -4.4987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7064   -3.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1186   -3.7156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3723   -4.5007    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5481   -3.0112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1526   -2.2872    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3729   -3.0307    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9052   -2.2631    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.6762   -4.9115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6758   -5.7365    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3900   -6.1493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1047   -5.7372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3908   -4.4994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8150   -6.1529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5291   -5.7414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5300   -4.9155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8106   -4.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0994   -4.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1269   -7.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8415   -7.0584    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5559   -7.4710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2704   -7.0585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9848   -7.4711    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6993   -7.0587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8121   -6.9779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0962   -7.3879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  8 16  1  0
  1  6  2  0
 16 17  1  0
  2  3  2  0
 17 18  1  0
  3  4  1  0
 18 19  1  0
  8  9  2  0
 16 20  2  0
  9 10  1  0
 19 21  2  0
 10 11  2  0
 21 22  1  0
 11  7  1  0
 22 23  2  0
  6  7  1  0
 23 24  1  0
  4  5  2  0
 24 25  2  0
 25 19  1  0
 10 12  1  0
  2 26  1  0
  5  6  1  0
 26 27  1  0
 12 13  1  0
 27 28  1  0
  7  8  1  0
 28 29  1  0
 12 14  1  0
 29 30  1  0
 30 31  1  0
 12 15  1  0
 21 32  1  0
  1  2  1  0
 32 33  1  0
M  END

Associated Targets(non-human)

Carm1 Histone-arginine methyltransferase CARM1 (53 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 459.52Molecular Weight (Monoisotopic): 459.2246AlogP: 3.69#Rotatable Bonds: 10
Polar Surface Area: 70.98Molecular Species: BASEHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.70CX Basic pKa: 9.61CX LogP: 4.19CX LogD: 1.98
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.40Np Likeness Score: -1.32

References

1. Therrien E, Larouche G, Manku S, Allan M, Nguyen N, Styhler S, Robert MF, Goulet AC, Besterman JM, Nguyen H, Wahhab A..  (2009)  1,2-Diamines as inhibitors of co-activator associated arginine methyltransferase 1 (CARM1).,  19  (23): [PMID:19836951] [10.1016/j.bmcl.2009.09.110]

Source