The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6,6-bis(4-fluorophenyl)-1-(4-(3,4,5-trimethoxybenzyl)piperazin-1-yl)hexan-1-one ID: ALA1088308
PubChem CID: 46880087
Max Phase: Preclinical
Molecular Formula: C32H38F2N2O4
Molecular Weight: 552.66
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CN2CCN(C(=O)CCCCC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc(OC)c1OC
Standard InChI: InChI=1S/C32H38F2N2O4/c1-38-29-20-23(21-30(39-2)32(29)40-3)22-35-16-18-36(19-17-35)31(37)7-5-4-6-28(24-8-12-26(33)13-9-24)25-10-14-27(34)15-11-25/h8-15,20-21,28H,4-7,16-19,22H2,1-3H3
Standard InChI Key: KMJUKMWZQZRWHI-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
-2.1778 -9.3788 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1778 -10.2043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4647 -10.6108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7517 -10.2043 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7517 -9.3788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4647 -8.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8903 -8.9662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6045 -9.3830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3206 -8.9672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0343 -9.3834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0323 -10.2097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3107 -10.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5999 -10.2037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3053 -11.4436 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.0181 -11.8630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7460 -10.6234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4632 -10.2158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7507 -8.9703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.7527 -8.1448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0369 -10.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6791 -10.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3940 -10.6181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1100 -10.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8207 -10.6202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5367 -10.2105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2516 -10.6222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5379 -9.3851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2543 -8.9737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2557 -8.1490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5404 -7.7366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8220 -8.1506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8240 -8.9739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2479 -11.4457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9619 -11.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6789 -11.4477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6774 -10.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9628 -10.2100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5405 -6.9111 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.3943 -11.8625 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.0381 -11.4415 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
4 20 1 0
9 10 1 0
20 21 1 0
3 4 1 0
21 22 1 0
10 11 2 0
22 23 1 0
4 5 1 0
23 24 1 0
11 12 1 0
24 25 1 0
5 6 1 0
25 26 1 0
12 13 2 0
25 27 1 0
13 8 1 0
27 28 2 0
28 29 1 0
12 14 1 0
29 30 2 0
1 7 1 0
30 31 1 0
14 15 1 0
31 32 2 0
32 27 1 0
1 2 1 0
26 33 2 0
11 16 1 0
33 34 1 0
7 8 1 0
34 35 2 0
16 17 1 0
35 36 1 0
1 6 1 0
36 37 2 0
37 26 1 0
10 18 1 0
30 38 1 0
8 9 2 0
35 39 1 0
18 19 1 0
20 40 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 552.66Molecular Weight (Monoisotopic): 552.2800AlogP: 6.03#Rotatable Bonds: 12Polar Surface Area: 51.24Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.95CX LogP: 5.83CX LogD: 5.82Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.26Np Likeness Score: -0.64
References 1. Zamponi GW, Feng ZP, Zhang L, Pajouhesh H, Ding Y, Belardetti F, Pajouhesh H, Dolphin D, Mitscher LA, Snutch TP.. (2009) Scaffold-based design and synthesis of potent N-type calcium channel blockers., 19 (22): [PMID:19815411 ] [10.1016/j.bmcl.2009.09.008 ]