6,6-bis(4-fluorophenyl)-1-(4-(3,4,5-trimethoxybenzyl)piperazin-1-yl)hexan-1-one

ID: ALA1088308

PubChem CID: 46880087

Max Phase: Preclinical

Molecular Formula: C32H38F2N2O4

Molecular Weight: 552.66

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(CN2CCN(C(=O)CCCCC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc(OC)c1OC

Standard InChI:  InChI=1S/C32H38F2N2O4/c1-38-29-20-23(21-30(39-2)32(29)40-3)22-35-16-18-36(19-17-35)31(37)7-5-4-6-28(24-8-12-26(33)13-9-24)25-10-14-27(34)15-11-25/h8-15,20-21,28H,4-7,16-19,22H2,1-3H3

Standard InChI Key:  KMJUKMWZQZRWHI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
   -2.1778   -9.3788    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1778  -10.2043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4647  -10.6108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7517  -10.2043    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7517   -9.3788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4647   -8.9599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8903   -8.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6045   -9.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3206   -8.9672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0343   -9.3834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0323  -10.2097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3107  -10.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5999  -10.2037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3053  -11.4436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0181  -11.8630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7460  -10.6234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4632  -10.2158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7507   -8.9703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7527   -8.1448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0369  -10.6160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6791  -10.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3940  -10.6181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1100  -10.2084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8207  -10.6202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5367  -10.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2516  -10.6222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5379   -9.3851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2543   -8.9737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2557   -8.1490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5404   -7.7366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8220   -8.1506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8240   -8.9739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2479  -11.4457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9619  -11.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6789  -11.4477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6774  -10.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9628  -10.2100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5405   -6.9111    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.3943  -11.8625    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0381  -11.4415    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  4 20  1  0
  9 10  1  0
 20 21  1  0
  3  4  1  0
 21 22  1  0
 10 11  2  0
 22 23  1  0
  4  5  1  0
 23 24  1  0
 11 12  1  0
 24 25  1  0
  5  6  1  0
 25 26  1  0
 12 13  2  0
 25 27  1  0
 13  8  1  0
 27 28  2  0
 28 29  1  0
 12 14  1  0
 29 30  2  0
  1  7  1  0
 30 31  1  0
 14 15  1  0
 31 32  2  0
 32 27  1  0
  1  2  1  0
 26 33  2  0
 11 16  1  0
 33 34  1  0
  7  8  1  0
 34 35  2  0
 16 17  1  0
 35 36  1  0
  1  6  1  0
 36 37  2  0
 37 26  1  0
 10 18  1  0
 30 38  1  0
  8  9  2  0
 35 39  1  0
 18 19  1  0
 20 40  2  0
M  END

Associated Targets(non-human)

Cacna2d1 Voltage-dependent L-type calcium channel subunit beta-1/alpha-1B/alpha-2/delta-1 (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 552.66Molecular Weight (Monoisotopic): 552.2800AlogP: 6.03#Rotatable Bonds: 12
Polar Surface Area: 51.24Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 5.95CX LogP: 5.83CX LogD: 5.82
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.26Np Likeness Score: -0.64

References

1. Zamponi GW, Feng ZP, Zhang L, Pajouhesh H, Ding Y, Belardetti F, Pajouhesh H, Dolphin D, Mitscher LA, Snutch TP..  (2009)  Scaffold-based design and synthesis of potent N-type calcium channel blockers.,  19  (22): [PMID:19815411] [10.1016/j.bmcl.2009.09.008]

Source