(E)-4-(2,4-dichloro-5-methoxyphenylamino)-8-(4-morpholinobut-1-enyl)quinoline-3-carbonitrile

ID: ALA1088697

PubChem CID: 46889035

Max Phase: Preclinical

Molecular Formula: C25H24Cl2N4O2

Molecular Weight: 483.40

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(Nc2c(C#N)cnc3c(/C=C/CCN4CCOCC4)cccc23)c(Cl)cc1Cl

Standard InChI:  InChI=1S/C25H24Cl2N4O2/c1-32-23-14-22(20(26)13-21(23)27)30-25-18(15-28)16-29-24-17(6-4-7-19(24)25)5-2-3-8-31-9-11-33-12-10-31/h2,4-7,13-14,16H,3,8-12H2,1H3,(H,29,30)/b5-2+

Standard InChI Key:  HXCCICBZAOSHPL-GORDUTHDSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    1.1636   -3.1664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4507   -2.7514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2665   -3.1664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2665   -3.9881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4507   -4.4031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1636   -3.9881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3068   -2.7514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0198   -3.1664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5897   -3.1664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8766   -2.7514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5887   -4.4031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3017   -4.8139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7327   -1.9297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7327   -2.7514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1587   -1.9297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4457   -1.5148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1587   -2.7514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4457   -3.1664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4457   -3.9881    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1587   -4.4031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8758   -3.9881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8758   -3.1664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2992   -3.1699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2992   -3.9916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0122   -4.4066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7293   -3.9916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7293   -3.1699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0122   -2.7549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0122   -1.9332    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.4423   -4.4066    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.5885   -2.7509    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0112   -5.2316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7251   -5.6450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10  1  1  0
 11 12  3  0
 13 14  2  0
 14 18  1  0
 17 15  1  0
 15 16  2  0
 16 13  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 17  2  0
 21 11  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 28 29  1  0
 26 30  1  0
 14  8  1  0
 22 31  1  0
 31 23  1  0
 25 32  1  0
  1  2  1  0
 32 33  1  0
M  END

Associated Targets(Human)

SRC Tclin Tyrosine-protein kinase SRC (10310 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.40Molecular Weight (Monoisotopic): 482.1276AlogP: 5.90#Rotatable Bonds: 7
Polar Surface Area: 70.41Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.60CX LogP: 5.10CX LogD: 4.68
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.45Np Likeness Score: -1.13

References

1. Boschelli DH, Wang D, Wang Y, Wu B, Honores EE, Barrios Sosa AC, Chaudhary I, Golas J, Lucas J, Boschelli F..  (2010)  Optimization of 7-alkene-3-quinolinecarbonitriles as Src kinase inhibitors.,  20  (9): [PMID:20363128] [10.1016/j.bmcl.2010.03.025]

Source