The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,6-difluoro-N-(3-(5-(2-(3-morpholinophenylamino)pyrimidin-4-yl)imidazo[2,1-b]thiazol-6-yl)phenyl)benzamide ID: ALA1088931
PubChem CID: 46886320
Max Phase: Preclinical
Molecular Formula: C32H25F2N7O2S
Molecular Weight: 609.66
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cccc(-c2nc3sccn3c2-c2ccnc(Nc3cccc(N4CCOCC4)c3)n2)c1)c1c(F)cccc1F
Standard InChI: InChI=1S/C32H25F2N7O2S/c33-24-8-3-9-25(34)27(24)30(42)36-21-5-1-4-20(18-21)28-29(41-14-17-44-32(41)39-28)26-10-11-35-31(38-26)37-22-6-2-7-23(19-22)40-12-15-43-16-13-40/h1-11,14,17-19H,12-13,15-16H2,(H,36,42)(H,35,37,38)
Standard InChI Key: UGZVJMYKCCZXOJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 50 0 0 0 0 0 0 0 0999 V2000
4.6089 -2.6368 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9240 -2.1766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9800 -1.3533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1830 -2.5397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7233 -0.9931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7797 -0.1706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0942 0.2905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3505 -0.0769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2976 -0.8984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5580 -1.2642 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.4072 -1.4551 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.8624 -3.8528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8364 -4.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5386 -5.1143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2675 -4.7225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2896 -3.8920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5866 -3.4615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9707 -5.1530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9893 -5.9786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7492 -4.8800 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2497 -5.5360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7826 -6.2142 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2832 -6.8681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0598 -6.5941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0391 -5.7709 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.2837 -6.4036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5616 -6.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8547 -6.4264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2996 -7.2254 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5957 -7.6522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8650 -7.2533 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6147 -8.4769 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9075 -8.9025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1902 -8.5001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4835 -8.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4979 -9.7507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2249 -10.1502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9286 -9.7233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2426 -10.9753 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5357 -11.3967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5513 -12.2181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2729 -12.6193 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9804 -12.1926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9663 -11.3649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 3 1 0
9 10 1 0
5 11 1 0
1 2 1 0
2 3 1 0
2 4 2 0
3 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
15 18 1 0
21 22 1 0
15 16 1 0
13 14 1 0
16 17 2 0
17 12 1 0
18 19 2 0
22 23 1 0
23 24 2 0
24 25 1 0
30 32 1 0
25 21 1 0
32 33 1 0
12 13 2 0
33 34 2 0
14 15 2 0
34 35 1 0
26 27 2 0
35 36 2 0
36 37 1 0
27 28 1 0
37 38 2 0
38 33 1 0
28 31 2 0
19 22 1 0
30 29 2 0
37 39 1 0
39 40 1 0
29 26 1 0
19 26 1 0
30 31 1 0
21 20 2 0
20 18 1 0
39 44 1 0
40 41 1 0
41 42 1 0
42 43 1 0
43 44 1 0
17 1 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 609.66Molecular Weight (Monoisotopic): 609.1759AlogP: 6.63#Rotatable Bonds: 7Polar Surface Area: 96.68Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.00CX Basic pKa: 2.67CX LogP: 6.24CX LogD: 6.24Aromatic Rings: 6Heavy Atoms: 44QED Weighted: 0.21Np Likeness Score: -2.08
References 1. Fidanze SD, Erickson SA, Wang GT, Mantei R, Clark RF, Sorensen BK, Bamaung NY, Kovar P, Johnson EF, Swinger KK, Stewart KD, Zhang Q, Tucker LA, Pappano WN, Wilsbacher JL, Wang J, Sheppard GS, Bell RL, Davidsen SK, Hubbard RD.. (2010) Imidazo[2,1-b]thiazoles: multitargeted inhibitors of both the insulin-like growth factor receptor and members of the epidermal growth factor family of receptor tyrosine kinases., 20 (8): [PMID:20346655 ] [10.1016/j.bmcl.2010.03.015 ]