The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-butyl 2-((S)-1-((1R,2S)-2-(4-(methylthio)benzylamino)cyclohexyl)-2-oxopyrrolidin-3-ylcarbamoyl)-4-(trifluoromethyl)phenylcarbamate ID: ALA1088933
PubChem CID: 46886509
Max Phase: Preclinical
Molecular Formula: C31H39F3N4O4S
Molecular Weight: 620.74
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CSc1ccc(CN[C@H]2CCCC[C@H]2N2CC[C@H](NC(=O)c3cc(C(F)(F)F)ccc3NC(=O)OC(C)(C)C)C2=O)cc1
Standard InChI: InChI=1S/C31H39F3N4O4S/c1-30(2,3)42-29(41)37-23-14-11-20(31(32,33)34)17-22(23)27(39)36-25-15-16-38(28(25)40)26-8-6-5-7-24(26)35-18-19-9-12-21(43-4)13-10-19/h9-14,17,24-26,35H,5-8,15-16,18H2,1-4H3,(H,36,39)(H,37,41)/t24-,25-,26+/m0/s1
Standard InChI Key: TYQZZRQBYYICKJ-KKUQBAQOSA-N
Molfile:
RDKit 2D
43 46 0 0 0 0 0 0 0 0999 V2000
15.5324 -13.6534 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2460 -14.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9614 -13.6566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2441 -14.8925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6710 -14.0739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3859 -13.6637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3882 -12.8378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6696 -12.4239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9577 -12.8365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6686 -11.5989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3825 -11.1855 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.9536 -11.1873 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.6636 -10.7704 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.6666 -14.8989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3788 -15.3152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3744 -16.1402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0955 -14.9066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8077 -15.3229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5244 -14.9142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8033 -16.1479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5177 -15.7329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1152 -13.8583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1141 -14.6857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8289 -15.0985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5453 -14.6852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5425 -13.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8271 -13.4455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4007 -13.4460 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.4005 -12.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2605 -15.0966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9743 -14.6829 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9730 -13.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6902 -13.4474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6909 -12.6260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9776 -12.2107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2619 -12.6231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2596 -13.4508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4042 -13.8607 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6447 -14.6504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4695 -14.6691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7422 -13.8905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0859 -13.3906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1054 -12.5658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
10 11 1 0
22 23 2 0
5 6 1 0
23 24 1 0
10 12 1 0
24 25 2 0
1 2 1 0
25 26 1 0
10 13 1 0
26 27 2 0
27 22 1 0
6 7 2 0
22 28 1 0
5 14 1 0
28 29 1 0
2 4 2 0
25 30 1 0
14 15 1 0
30 31 1 0
7 8 1 0
32 31 1 1
32 33 1 0
15 16 2 0
15 17 1 0
8 9 2 0
17 18 1 0
32 37 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
9 3 1 0
33 38 1 1
38 39 1 0
18 19 1 0
3 5 2 0
18 20 1 0
8 10 1 0
39 40 1 0
40 41 1 0
41 42 1 0
42 38 1 0
18 21 1 0
42 43 2 0
41 1 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 620.74Molecular Weight (Monoisotopic): 620.2644AlogP: 6.21#Rotatable Bonds: 8Polar Surface Area: 99.77Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.24CX Basic pKa: 9.00CX LogP: 5.46CX LogD: 3.86Aromatic Rings: 2Heavy Atoms: 43QED Weighted: 0.30Np Likeness Score: -1.08
References 1. Cherney RJ, Mo R, Meyer DT, Voss ME, Yang MG, Santella JB, Duncia JV, Lo YC, Yang G, Miller PB, Scherle PA, Zhao Q, Mandlekar S, Cvijic ME, Barrish JC, Decicco CP, Carter PH.. (2010) gamma-Lactams as glycinamide replacements in cyclohexane-based CC chemokine receptor 2 (CCR2) antagonists., 20 (8): [PMID:20346664 ] [10.1016/j.bmcl.2010.03.035 ]