4-Pregnen-21-ol-3,20-dione-21-(4-benzenesufonate)

ID: ALA1089066

PubChem CID: 44549901

Max Phase: Preclinical

Molecular Formula: C27H34O5S

Molecular Weight: 470.63

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)COS(=O)(=O)c1ccccc1

Standard InChI:  InChI=1S/C27H34O5S/c1-26-14-12-19(28)16-18(26)8-9-21-22-10-11-24(27(22,2)15-13-23(21)26)25(29)17-32-33(30,31)20-6-4-3-5-7-20/h3-7,16,21-24H,8-15,17H2,1-2H3/t21-,22-,23-,24+,26-,27-/m0/s1

Standard InChI Key:  FACHCVCZWGGDDC-YNHSGCSHSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    6.0853   -2.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0853   -1.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7970   -1.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7970   -2.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5129   -2.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2288   -2.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9446   -2.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9446   -1.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6563   -1.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4410   -1.4196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9257   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4406   -0.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8535    0.6298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6777    0.6329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6563   -0.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6563    0.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9446    0.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2288   -0.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2288   -1.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5129   -1.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5129   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2288   -1.9875    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.9446   -0.7500    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.6563   -1.9875    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3705   -2.8119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4396    1.3435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0874    1.3488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9114    1.3085    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.7349    1.3175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8958    0.4836    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9287    2.1333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1526    0.6066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9752    0.6152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3800    1.3334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9560    2.0443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1347    2.0322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 12 13  1  1
 13 14  1  0
 12 15  1  0
  9 15  1  0
 15 16  1  1
 15 17  1  0
 17 18  1  0
 18 19  1  0
  8 19  1  0
 19 20  1  0
  3 20  1  0
  5 20  1  0
 20 21  1  1
 19 22  1  6
  8 23  1  1
  9 24  1  6
  1 25  2  0
  1  2  1  0
 13 26  2  0
  2  3  1  0
 14 27  1  0
  1  4  1  0
 27 28  1  0
  4  5  2  0
 28 29  1  0
  5  6  1  0
 28 30  2  0
  6  7  1  0
 28 31  2  0
  7  8  1  0
 29 32  2  0
  8  9  1  0
 32 33  1  0
  9 10  1  0
 33 34  2  0
 10 11  1  0
 34 35  1  0
 11 12  1  0
 35 36  2  0
 36 29  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA1089066

   [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] benzenesulfonate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 470.63

Molecular Weight (Monoisotopic): 470.2127

AlogP: 5.11

#Rotatable Bonds: 5

Polar Surface Area: 77.51

Molecular Species: NEUTRAL

HBA: 5

HBD: ┄

#RO5 Violations: 1

HBA (Lipinski): 5

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): 1

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 5.38

CX LogD: 5.38

Aromatic Rings: 1

Heavy Atoms: 33

QED Weighted: 0.56

Np Likeness Score: 1.20

References

1. Dexheimer TS, Gediya LK, Stephen AG, Weidlich I, Antony S, Marchand C, Interthal H, Nicklaus M, Fisher RJ, Njar VC, Pommier Y..  (2009)  4-Pregnen-21-ol-3,20-dione-21-(4-bromobenzenesulfonate) (NSC 88915) and related novel steroid derivatives as tyrosyl-DNA phosphodiesterase (Tdp1) inhibitors.,  52  (22): [PMID:19883083] [10.1021/jm901061s]

Source

Source(1):

• Scientific Literature