The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Pregnen-21-ol-3,20-dione-21-(4-benzenesufonate) ID: ALA1089066
PubChem CID: 44549901
Max Phase: Preclinical
Molecular Formula: C27H34O5S
Molecular Weight: 470.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)COS(=O)(=O)c1ccccc1
Standard InChI: InChI=1S/C27H34O5S/c1-26-14-12-19(28)16-18(26)8-9-21-22-10-11-24(27(22,2)15-13-23(21)26)25(29)17-32-33(30,31)20-6-4-3-5-7-20/h3-7,16,21-24H,8-15,17H2,1-2H3/t21-,22-,23-,24+,26-,27-/m0/s1
Standard InChI Key: FACHCVCZWGGDDC-YNHSGCSHSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
6.0853 -2.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0853 -1.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7970 -1.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7970 -2.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5129 -2.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2288 -2.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9446 -2.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9446 -1.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6563 -1.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4410 -1.4196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9257 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4406 -0.0853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8535 0.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6777 0.6329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6563 -0.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6563 0.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9446 0.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2288 -0.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2288 -1.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5129 -1.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5129 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2288 -1.9875 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.9446 -0.7500 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.6563 -1.9875 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3705 -2.8119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4396 1.3435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0874 1.3488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9114 1.3085 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.7349 1.3175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8958 0.4836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9287 2.1333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1526 0.6066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9752 0.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3800 1.3334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9560 2.0443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1347 2.0322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12 13 1 1
13 14 1 0
12 15 1 0
9 15 1 0
15 16 1 1
15 17 1 0
17 18 1 0
18 19 1 0
8 19 1 0
19 20 1 0
3 20 1 0
5 20 1 0
20 21 1 1
19 22 1 6
8 23 1 1
9 24 1 6
1 25 2 0
1 2 1 0
13 26 2 0
2 3 1 0
14 27 1 0
1 4 1 0
27 28 1 0
4 5 2 0
28 29 1 0
5 6 1 0
28 30 2 0
6 7 1 0
28 31 2 0
7 8 1 0
29 32 2 0
8 9 1 0
32 33 1 0
9 10 1 0
33 34 2 0
10 11 1 0
34 35 1 0
11 12 1 0
35 36 2 0
36 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.63Molecular Weight (Monoisotopic): 470.2127AlogP: 5.11#Rotatable Bonds: 5Polar Surface Area: 77.51Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.38CX LogD: 5.38Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.56Np Likeness Score: 1.20
References 1. Dexheimer TS, Gediya LK, Stephen AG, Weidlich I, Antony S, Marchand C, Interthal H, Nicklaus M, Fisher RJ, Njar VC, Pommier Y.. (2009) 4-Pregnen-21-ol-3,20-dione-21-(4-bromobenzenesulfonate) (NSC 88915) and related novel steroid derivatives as tyrosyl-DNA phosphodiesterase (Tdp1) inhibitors., 52 (22): [PMID:19883083 ] [10.1021/jm901061s ]