Phenyl-2-deoxy-2-[3'-(8''-hydroxy-3''-methyl-1'',4''-dioxo-1'',4''-dihydronaphthalen-2''-yl)propanamido]-1-thio-alpha-D-glucopyranoside

ID: ALA1089085

Max Phase: Preclinical

Molecular Formula: C26H27NO8S

Molecular Weight: 513.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1=C(CCC(=O)N[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]2Sc2ccccc2)C(=O)c2c(O)cccc2C1=O

Standard InChI:  InChI=1S/C26H27NO8S/c1-13-15(23(32)20-16(22(13)31)8-5-9-17(20)29)10-11-19(30)27-21-25(34)24(33)18(12-28)35-26(21)36-14-6-3-2-4-7-14/h2-9,18,21,24-26,28-29,33-34H,10-12H2,1H3,(H,27,30)/t18-,21-,24-,25-,26-/m1/s1

Standard InChI Key:  PTRHLXSWTVRMIU-PBDOEIEUSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    8.6542    1.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6542    0.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3662    0.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0782    0.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0782    1.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3662    2.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7921    0.3448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3662   -0.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9403    0.3448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9385    1.9937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2252    1.5791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7939    1.9937    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.7963    2.8187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5127    3.2258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5155    4.0583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8017    4.4679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0836    4.0577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0844    3.2278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5071    0.7563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2210    0.3427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5083    1.5813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9361    0.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6500    0.3407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6422   -0.4887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3520   -0.9022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3584    0.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0727    0.3317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0683   -0.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7800   -0.9089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4967   -0.4992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4971    0.3297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7848    0.7408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9251   -0.8965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3608    1.5747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3481   -1.7272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7856    1.5658    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 17 18  2  0
 18 13  1  0
  2  9  1  6
  7 19  1  0
  2  3  1  0
 19 20  1  0
  1 10  1  1
 19 21  2  0
  3  4  1  0
 20 22  1  0
 10 11  1  0
 22 23  1  0
 23 24  2  0
  4  5  1  0
  5 12  1  6
  5  6  1  0
 23 26  1  0
 24 25  1  0
 25 28  1  0
 27 26  1  0
 12 13  1  0
 27 28  2  0
 13 14  2  0
 28 29  1  0
  4  7  1  6
 29 30  2  0
 14 15  1  0
 30 31  1  0
  1  2  1  0
 31 32  2  0
 32 27  1  0
 15 16  2  0
 24 33  1  0
  3  8  1  1
 26 34  2  0
 16 17  1  0
 25 35  2  0
  1  6  1  0
 32 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA1089085

    ---

Associated Targets(non-human)

mshB LmbE-related protein (42 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 513.57Molecular Weight (Monoisotopic): 513.1457AlogP: 1.58#Rotatable Bonds: 7
Polar Surface Area: 153.39Molecular Species: NEUTRALHBA: 9HBD: 5
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.26CX Basic pKa: CX LogP: 1.94CX LogD: 1.88
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: 0.91

References

1. Gammon DW, Steenkamp DJ, Mavumengwana V, Marakalala MJ, Mudzunga TT, Hunter R, Munyololo M..  (2010)  Conjugates of plumbagin and phenyl-2-amino-1-thioglucoside inhibit MshB, a deacetylase involved in the biosynthesis of mycothiol.,  18  (7): [PMID:20304659] [10.1016/j.bmc.2010.02.049]

Source