The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-Carbamimidoyl-N-(4-hexadecylphenyl)cyclopropanecarboxamide Hydrochloride ID: ALA1089342
PubChem CID: 46197663
Max Phase: Preclinical
Molecular Formula: C27H46ClN3O
Molecular Weight: 427.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCCCCCCc1ccc(NC(=O)C2(C(=N)N)CC2)cc1.Cl
Standard InChI: InChI=1S/C27H45N3O.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-23-17-19-24(20-18-23)30-26(31)27(21-22-27)25(28)29;/h17-20H,2-16,21-22H2,1H3,(H3,28,29)(H,30,31);1H
Standard InChI Key: UYVRJSZYGPLGEG-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 32 0 0 0 0 0 0 0 0999 V2000
9.5445 -10.7933 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.0858 -8.7428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4635 -8.0093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6379 -8.0462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5190 -9.1658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5176 -9.9934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2312 -10.4040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9466 -9.9929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9434 -9.1619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2292 -8.7508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8004 -10.3965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0894 -9.9863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3783 -10.3919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6673 -9.9817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9517 -10.3874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2406 -9.9771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5296 -10.3874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8186 -9.9727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6549 -8.7487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3697 -9.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8007 -9.1501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8040 -9.9751 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5122 -8.7369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1048 -10.3865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3877 -9.9708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3732 -9.9810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3261 -10.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0386 -9.9688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7524 -10.3828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4651 -9.9670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1833 -10.3808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8960 -9.9651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8 9 1 0
16 17 1 0
17 18 1 0
9 10 2 0
9 19 1 0
10 5 1 0
19 20 1 0
20 2 1 0
5 6 2 0
2 21 1 0
6 11 1 0
21 22 1 0
3 2 1 0
21 23 2 0
11 12 1 0
18 24 1 0
6 7 1 0
24 25 1 0
12 13 1 0
20 26 2 0
4 3 1 0
25 27 1 0
13 14 1 0
27 28 1 0
7 8 2 0
28 29 1 0
14 15 1 0
29 30 1 0
2 4 1 0
30 31 1 0
15 16 1 0
31 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 427.68Molecular Weight (Monoisotopic): 427.3563AlogP: 7.37#Rotatable Bonds: 18Polar Surface Area: 78.97Molecular Species: BASEHBA: 2HBD: 3#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.84CX Basic pKa: 10.95CX LogP: 8.18CX LogD: 5.80Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.13Np Likeness Score: -0.25
References 1. Mathews TP, Kennedy AJ, Kharel Y, Kennedy PC, Nicoara O, Sunkara M, Morris AJ, Wamhoff BR, Lynch KR, Macdonald TL.. (2010) Discovery, biological evaluation, and structure-activity relationship of amidine based sphingosine kinase inhibitors., 53 (7): [PMID:20205392 ] [10.1021/jm901860h ]