(2-fluorophenyl)(2-hydroxy-4,6-dimethoxyphenyl)methanone

ID: ALA1089356

PubChem CID: 46884269

Max Phase: Preclinical

Molecular Formula: C15H13FO4

Molecular Weight: 276.26

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)c(C(=O)c2ccccc2F)c(OC)c1

Standard InChI:  InChI=1S/C15H13FO4/c1-19-9-7-12(17)14(13(8-9)20-2)15(18)10-5-3-4-6-11(10)16/h3-8,17H,1-2H3

Standard InChI Key:  ZVMJVOOHVFHMNW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 20 21  0  0  0  0  0  0  0  0999 V2000
   -3.9973    1.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9984    0.2643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2836   -0.1485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5672    0.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5700    1.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2854    1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7132   -0.1476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4274    0.2655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2879    2.3295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5746    2.7441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8520   -0.1466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8571    1.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1411    1.1007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8602    2.3355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1413    0.2781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4262   -0.1317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2877    0.2836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2820    1.1128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4338    1.5188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4412    2.3438    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  9 10  1  0
  2  3  1  0
  4 11  1  0
  5  6  2  0
  5 12  1  0
  6  1  1  0
 12 13  1  0
  1  2  2  0
 12 14  2  0
  2  7  1  0
 13 15  2  0
  3  4  2  0
 15 16  1  0
  7  8  1  0
 16 17  2  0
 17 18  1  0
  6  9  1  0
 18 19  2  0
 19 13  1  0
  4  5  1  0
 19 20  1  0
M  END

Associated Targets(Human)

THP-1 (11052 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 276.26Molecular Weight (Monoisotopic): 276.0798AlogP: 2.78#Rotatable Bonds: 4
Polar Surface Area: 55.76Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.11CX Basic pKa: CX LogP: 3.61CX LogD: 3.14
Aromatic Rings: 2Heavy Atoms: 20QED Weighted: 0.87Np Likeness Score: -0.12

References

1. Bandgar BP, Patil SA, Totre JV, Korbad BL, Gacche RN, Hote BS, Jalde SS, Chavan HV..  (2010)  Synthesis and biological evaluation of nitrogen-containing benzophenone analogues as TNF-alpha and IL-6 inhibitors with antioxidant activity.,  20  (7): [PMID:20207143] [10.1016/j.bmcl.2010.02.001]

Source