The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-Furyl)-7-[4-(methoxyphenyl)acetyl]amino-5-phenoxy[1,2,4]triazolo[1,5-a]-[1,3,5]triazine ID: ALA1089438
PubChem CID: 46885516
Max Phase: Preclinical
Molecular Formula: C23H18N6O4
Molecular Weight: 442.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CC(=O)Nc2nc(Oc3ccccc3)nc3nc(-c4ccco4)nn23)cc1
Standard InChI: InChI=1S/C23H18N6O4/c1-31-16-11-9-15(10-12-16)14-19(30)24-21-26-23(33-17-6-3-2-4-7-17)27-22-25-20(28-29(21)22)18-8-5-13-32-18/h2-13H,14H2,1H3,(H,24,25,26,27,28,30)
Standard InChI Key: PSVHAWJNCNBNAP-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
21.8027 -25.6208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8016 -26.4482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5164 -26.8610 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.5146 -25.2080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2300 -25.6172 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2349 -26.4482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0267 -26.7004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5113 -26.0252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0188 -25.3558 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.5121 -24.3830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3375 -26.0153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8264 -26.6798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.6095 -26.4203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6046 -25.5952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8185 -25.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0868 -26.8601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3726 -26.4470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3737 -25.6222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6604 -25.2092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9446 -25.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9466 -26.4504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6605 -26.8597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2254 -23.9684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2229 -23.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9411 -24.3788 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5072 -22.7330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5064 -21.9108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7915 -21.5005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0773 -21.9152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0824 -22.7445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7979 -23.1510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3646 -21.5059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6519 -21.9214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 4 1 0
2 16 1 0
6 7 2 0
16 17 1 0
7 8 1 0
17 18 2 0
8 9 2 0
18 19 1 0
9 5 1 0
19 20 2 0
4 1 2 0
20 21 1 0
4 10 1 0
21 22 2 0
22 17 1 0
11 12 1 0
10 23 1 0
5 6 1 0
23 24 1 0
23 25 2 0
2 3 2 0
24 26 1 0
3 6 1 0
26 27 2 0
1 2 1 0
27 28 1 0
12 13 1 0
28 29 2 0
13 14 2 0
29 30 1 0
14 15 1 0
30 31 2 0
31 26 1 0
15 11 2 0
8 11 1 0
32 33 1 0
29 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.44Molecular Weight (Monoisotopic): 442.1390AlogP: 3.76#Rotatable Bonds: 7Polar Surface Area: 116.67Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.41CX Basic pKa: ┄CX LogP: 4.83CX LogD: 4.54Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.40Np Likeness Score: -1.59
References 1. Pastorin G, Federico S, Paoletta S, Corradino M, Cateni F, Cacciari B, Klotz KN, Gao ZG, Jacobson KA, Spalluto G, Moro S.. (2010) Synthesis and pharmacological characterization of a new series of 5,7-disubstituted-[1,2,4]triazolo[1,5-a][1,3,5]triazine derivatives as adenosine receptor antagonists: A preliminary inspection of ligand-receptor recognition process., 18 (7): [PMID:20304654 ] [10.1016/j.bmc.2010.02.039 ]