furan-2-yl(4-((6-(4-(propylsulfonyl)piperazin-1-yl)pyridin-3-yloxy)methyl)piperidin-1-yl)methanone

ID: ALA1089837

PubChem CID: 46885048

Max Phase: Preclinical

Molecular Formula: C23H32N4O5S

Molecular Weight: 476.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCS(=O)(=O)N1CCN(c2ccc(OCC3CCN(C(=O)c4ccco4)CC3)cn2)CC1

Standard InChI:  InChI=1S/C23H32N4O5S/c1-2-16-33(29,30)27-13-11-25(12-14-27)22-6-5-20(17-24-22)32-18-19-7-9-26(10-8-19)23(28)21-4-3-15-31-21/h3-6,15,17,19H,2,7-14,16,18H2,1H3

Standard InChI Key:  JHFKKMFMYPSKOV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    7.1277  -12.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1266  -13.5482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8414  -13.9610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5578  -13.5477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5550  -12.7172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8396  -12.3080    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4093  -12.3040    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4111  -11.4781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7007  -11.0658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9839  -11.4750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9821  -12.3010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6971  -12.7178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2730  -13.9591    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9868  -13.5454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7019  -13.9568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6991  -14.7799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4101  -15.1912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1264  -14.7811    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1271  -13.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4115  -13.5392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8400  -15.1951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8381  -16.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5553  -14.7842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2709  -11.0600    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.5549  -11.4699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6833  -10.4708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8542  -10.4708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8419  -11.0549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1260  -11.4649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1725  -16.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4257  -17.2914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2507  -17.2932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5073  -16.5092    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  2  0
  4  5  1  0
  2  3  1  0
  5  6  2  0
 15 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
  7 12  1  0
 18 21  1  0
  8  9  1  0
 21 22  1  0
  9 10  1  0
 21 23  2  0
 10 11  1  0
 10 24  1  0
 11 12  1  0
 24 25  1  0
  1  7  1  0
 24 26  2  0
  6  1  1  0
 24 27  2  0
  4 13  1  0
 25 28  1  0
  7  8  1  0
 28 29  1  0
 22 30  2  0
 13 14  1  0
  1  2  2  0
 14 15  1  0
 15 16  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 22  1  0
M  END

Associated Targets(Human)

GPR119 Tclin Glucose-dependent insulinotropic receptor (4762 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 476.60Molecular Weight (Monoisotopic): 476.2093AlogP: 2.47#Rotatable Bonds: 8
Polar Surface Area: 96.19Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.73CX LogP: 1.53CX LogD: 1.52
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.58Np Likeness Score: -2.17

References

1. Wu Y, Kuntz JD, Carpenter AJ, Fang J, Sauls HR, Gomez DJ, Ammala C, Xu Y, Hart S, Tadepalli S..  (2010)  2,5-Disubstituted pyridines as potent GPR119 agonists.,  20  (8): [PMID:20227877] [10.1016/j.bmcl.2010.02.083]

Source