morpholino(4-((6-(4-(propylsulfonyl)piperazin-1-yl)pyridin-3-yloxy)methyl)piperidin-1-yl)methanone

ID: ALA1089838

PubChem CID: 46885049

Max Phase: Preclinical

Molecular Formula: C23H37N5O5S

Molecular Weight: 495.65

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCS(=O)(=O)N1CCN(c2ccc(OCC3CCN(C(=O)N4CCOCC4)CC3)cn2)CC1

Standard InChI:  InChI=1S/C23H37N5O5S/c1-2-17-34(30,31)28-11-9-25(10-12-28)22-4-3-21(18-24-22)33-19-20-5-7-26(8-6-20)23(29)27-13-15-32-16-14-27/h3-4,18,20H,2,5-17,19H2,1H3

Standard InChI Key:  PNLYWRXTTZTKPC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   17.4527  -12.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4516  -13.5898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1664  -14.0027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8828  -13.5894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8800  -12.7588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1646  -12.3497    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7343  -12.3457    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7361  -11.5197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0257  -11.1075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3089  -11.5167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3071  -12.3426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0221  -12.7594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5980  -14.0007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3118  -13.5871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0269  -13.9985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0241  -14.8215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7351  -15.2328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4514  -14.8227    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.4521  -13.9968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7365  -13.5809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1650  -15.2368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1631  -16.0618    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.8803  -14.8259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5959  -11.1016    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.8799  -11.5116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0083  -10.5125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1792  -10.5125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1669  -11.0966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4510  -11.5065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4489  -16.4690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4451  -17.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1568  -17.7083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.8740  -17.2986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8795  -16.4710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  5  1  0
  2  3  1  0
  5  6  2  0
 15 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
  7 12  1  0
 18 21  1  0
  8  9  1  0
 21 22  1  0
  9 10  1  0
 21 23  2  0
 10 11  1  0
 10 24  1  0
 11 12  1  0
 24 25  1  0
  1  7  1  0
 24 26  2  0
  6  1  1  0
 24 27  2  0
  4 13  1  0
 25 28  1  0
  7  8  1  0
 28 29  1  0
 22 30  1  0
 13 14  1  0
  1  2  2  0
 14 15  1  0
 15 16  1  0
  3  4  2  0
 22 34  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
M  END

Associated Targets(Human)

GPR119 Tclin Glucose-dependent insulinotropic receptor (4762 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 495.65Molecular Weight (Monoisotopic): 495.2515AlogP: 1.49#Rotatable Bonds: 7
Polar Surface Area: 95.52Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.73CX LogP: 0.51CX LogD: 0.50
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.57Np Likeness Score: -2.01

References

1. Wu Y, Kuntz JD, Carpenter AJ, Fang J, Sauls HR, Gomez DJ, Ammala C, Xu Y, Hart S, Tadepalli S..  (2010)  2,5-Disubstituted pyridines as potent GPR119 agonists.,  20  (8): [PMID:20227877] [10.1016/j.bmcl.2010.02.083]

Source