N-(4-isopropylphenyl)-4-((6-(4-(propylsulfonyl)piperazin-1-yl)pyridin-3-yloxy)methyl)piperidine-1-carboxamide

ID: ALA1089839

PubChem CID: 46885050

Max Phase: Preclinical

Molecular Formula: C28H41N5O4S

Molecular Weight: 543.73

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCS(=O)(=O)N1CCN(c2ccc(OCC3CCN(C(=O)Nc4ccc(C(C)C)cc4)CC3)cn2)CC1

Standard InChI:  InChI=1S/C28H41N5O4S/c1-4-19-38(35,36)33-17-15-31(16-18-33)27-10-9-26(20-29-27)37-21-23-11-13-32(14-12-23)28(34)30-25-7-5-24(6-8-25)22(2)3/h5-10,20,22-23H,4,11-19,21H2,1-3H3,(H,30,34)

Standard InChI Key:  ZCLFJHMMUILSLE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   -1.8889  -18.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8901  -19.7898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1753  -20.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4588  -19.7894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4617  -18.9588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1771  -18.5497    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6073  -18.5457    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6055  -17.7197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3160  -17.3075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0328  -17.7167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0346  -18.5426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3196  -18.9594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2563  -20.2007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9701  -19.7871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6852  -20.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6825  -21.0215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3935  -21.4328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1097  -21.0227    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1104  -20.1968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3949  -19.7809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8233  -21.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8215  -22.2618    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5387  -21.0259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7458  -17.3016    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4617  -17.7116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3333  -16.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1625  -16.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1753  -17.2966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8927  -17.7065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5350  -22.6759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5294  -23.5009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2388  -23.9148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9566  -23.5074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9604  -22.6815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2464  -22.2629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6686  -23.9242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6637  -24.7492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3855  -23.5160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 15 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
  7 12  1  0
 18 21  1  0
  8  9  1  0
 21 22  1  0
  9 10  1  0
 21 23  2  0
 10 11  1  0
 10 24  1  0
 11 12  1  0
 24 25  1  0
  1  7  1  0
 24 26  2  0
  6  1  1  0
 24 27  2  0
  4 13  1  0
 25 28  1  0
  7  8  1  0
 28 29  1  0
 13 14  1  0
 22 30  1  0
 30 31  2  0
  1  2  2  0
 14 15  1  0
 15 16  1  0
  3  4  2  0
 30 35  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
  4  5  1  0
 33 36  1  0
  2  3  1  0
 36 37  1  0
  5  6  2  0
 36 38  1  0
M  END

Associated Targets(Human)

GPR119 Tclin Glucose-dependent insulinotropic receptor (4762 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 543.73Molecular Weight (Monoisotopic): 543.2879AlogP: 4.39#Rotatable Bonds: 9
Polar Surface Area: 95.08Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.73CX Basic pKa: 5.73CX LogP: 3.77CX LogD: 3.76
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.50Np Likeness Score: -2.04

References

1. Wu Y, Kuntz JD, Carpenter AJ, Fang J, Sauls HR, Gomez DJ, Ammala C, Xu Y, Hart S, Tadepalli S..  (2010)  2,5-Disubstituted pyridines as potent GPR119 agonists.,  20  (8): [PMID:20227877] [10.1016/j.bmcl.2010.02.083]

Source