The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-isopropylphenyl)-4-((6-(4-(propylsulfonyl)piperazin-1-yl)pyridin-3-yloxy)methyl)piperidine-1-carboxamide ID: ALA1089839
PubChem CID: 46885050
Max Phase: Preclinical
Molecular Formula: C28H41N5O4S
Molecular Weight: 543.73
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCS(=O)(=O)N1CCN(c2ccc(OCC3CCN(C(=O)Nc4ccc(C(C)C)cc4)CC3)cn2)CC1
Standard InChI: InChI=1S/C28H41N5O4S/c1-4-19-38(35,36)33-17-15-31(16-18-33)27-10-9-26(20-29-27)37-21-23-11-13-32(14-12-23)28(34)30-25-7-5-24(6-8-25)22(2)3/h5-10,20,22-23H,4,11-19,21H2,1-3H3,(H,30,34)
Standard InChI Key: ZCLFJHMMUILSLE-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
-1.8889 -18.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8901 -19.7898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1753 -20.2027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4588 -19.7894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4617 -18.9588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1771 -18.5497 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6073 -18.5457 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6055 -17.7197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3160 -17.3075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0328 -17.7167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.0346 -18.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3196 -18.9594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2563 -20.2007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9701 -19.7871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6852 -20.1985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6825 -21.0215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3935 -21.4328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1097 -21.0227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1104 -20.1968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3949 -19.7809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8233 -21.4368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8215 -22.2618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5387 -21.0259 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.7458 -17.3016 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-5.4617 -17.7116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3333 -16.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.1625 -16.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.1753 -17.2966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.8927 -17.7065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5350 -22.6759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5294 -23.5009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2388 -23.9148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9566 -23.5074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9604 -22.6815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2464 -22.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6686 -23.9242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6637 -24.7492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3855 -23.5160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
7 12 1 0
18 21 1 0
8 9 1 0
21 22 1 0
9 10 1 0
21 23 2 0
10 11 1 0
10 24 1 0
11 12 1 0
24 25 1 0
1 7 1 0
24 26 2 0
6 1 1 0
24 27 2 0
4 13 1 0
25 28 1 0
7 8 1 0
28 29 1 0
13 14 1 0
22 30 1 0
30 31 2 0
1 2 2 0
14 15 1 0
15 16 1 0
3 4 2 0
30 35 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
4 5 1 0
33 36 1 0
2 3 1 0
36 37 1 0
5 6 2 0
36 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 543.73Molecular Weight (Monoisotopic): 543.2879AlogP: 4.39#Rotatable Bonds: 9Polar Surface Area: 95.08Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.73CX Basic pKa: 5.73CX LogP: 3.77CX LogD: 3.76Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.50Np Likeness Score: -2.04
References 1. Wu Y, Kuntz JD, Carpenter AJ, Fang J, Sauls HR, Gomez DJ, Ammala C, Xu Y, Hart S, Tadepalli S.. (2010) 2,5-Disubstituted pyridines as potent GPR119 agonists., 20 (8): [PMID:20227877 ] [10.1016/j.bmcl.2010.02.083 ]