(R)-N-(2-(1-(2-(1-(2-methylbenzoyl)piperidin-4-yl)ethyl)pyrrolidin-3-ylamino)-2-oxoethyl)-3-(trifluoromethyl)benzamide

ID: ALA1090206

PubChem CID: 46842084

Max Phase: Preclinical

Molecular Formula: C29H35F3N4O3

Molecular Weight: 544.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccccc1C(=O)N1CCC(CCN2CC[C@@H](NC(=O)CNC(=O)c3cccc(C(F)(F)F)c3)C2)CC1

Standard InChI:  InChI=1S/C29H35F3N4O3/c1-20-5-2-3-8-25(20)28(39)36-15-10-21(11-16-36)9-13-35-14-12-24(19-35)34-26(37)18-33-27(38)22-6-4-7-23(17-22)29(30,31)32/h2-8,17,21,24H,9-16,18-19H2,1H3,(H,33,38)(H,34,37)/t24-/m1/s1

Standard InChI Key:  NXRPRWZMYABEPP-XMMPIXPASA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   11.5667   -6.0775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5655   -6.9050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2830   -7.3179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9978   -6.9046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9946   -6.0734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2810   -5.6647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7055   -5.6579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4244   -6.0675    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.7020   -4.8329    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.4191   -5.2387    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.8540   -5.6651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8538   -4.8401    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1370   -6.0778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4243   -5.6655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7072   -6.0781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9946   -5.6659    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7075   -6.9031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2822   -6.0781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4985   -5.8300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0208   -6.5025    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5139   -7.1653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2951   -6.9005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1959   -6.5150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7728   -5.8040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9479   -5.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5251   -5.1028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7041   -5.1129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2981   -5.8297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7199   -6.5381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5477   -6.5342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4731   -5.8386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0683   -6.5555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0529   -5.1259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4635   -4.4103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0441   -3.6982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2182   -3.7065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1863   -4.4291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2311   -5.1380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1707   -5.8566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  5  1  0
  7 10  1  0
  2  3  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 18  1  0
  1 11  1  0
 20 23  1  0
  5  6  2  0
 23 24  1  0
 11 12  2  0
 24 25  1  0
 25 26  1  0
  6  1  1  0
 11 13  1  0
  1  2  2  0
 13 14  1  0
  5  7  1  0
 25 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 14 15  1  0
 28 31  1  0
  3  4  2  0
 31 32  2  0
 15 16  1  0
 31 33  1  0
  7  8  1  0
 33 34  2  0
 15 17  2  0
 34 35  1  0
 35 36  2  0
 18 16  1  6
 36 37  1  0
 18 19  1  0
 37 38  2  0
 38 33  1  0
  7  9  1  0
 38 39  1  0
M  END

Associated Targets(Human)

CCR2 Tchem C-C chemokine receptor type 2 (5628 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 544.62Molecular Weight (Monoisotopic): 544.2661AlogP: 3.88#Rotatable Bonds: 8
Polar Surface Area: 81.75Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.01CX LogP: 3.24CX LogD: 1.62
Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.53Np Likeness Score: -1.83

References

1. Lim JW, Oh Y, Kim JH, Oak MH, Na Y, Lee JO, Lee SW, Cho H, Park WK, Choi G, Kang J..  (2010)  Synthesis and biological evaluation of 3-aminopyrrolidine derivatives as CC chemokine receptor 2 antagonists.,  20  (7): [PMID:20223662] [10.1016/j.bmcl.2010.02.072]

Source