The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,5-bis(4-(tetrahydro-2H-pyran-3-yloxy)benzylidene)cyclopentanone ID: ALA1090244
PubChem CID: 46886113
Max Phase: Preclinical
Molecular Formula: C29H32O5
Molecular Weight: 460.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1/C(=C/c2ccc(OC3CCCOC3)cc2)CC/C1=C\c1ccc(OC2CCCOC2)cc1
Standard InChI: InChI=1S/C29H32O5/c30-29-23(17-21-5-11-25(12-6-21)33-27-3-1-15-31-19-27)9-10-24(29)18-22-7-13-26(14-8-22)34-28-4-2-16-32-20-28/h5-8,11-14,17-18,27-28H,1-4,9-10,15-16,19-20H2/b23-17+,24-18+
Standard InChI Key: RFWQDJMWKUXTKI-GJHDBBOXSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
12.8625 -8.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6875 -8.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9447 -8.0072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2750 -7.5208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6094 -8.0078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8940 -7.5966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1803 -8.0103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6578 -7.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3739 -8.0015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3747 -8.8272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0899 -9.2369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8038 -8.8217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7980 -7.9924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0822 -7.5864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4653 -7.5972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7521 -8.0103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7530 -8.8362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4732 -9.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1836 -8.8318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2735 -6.6958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0398 -9.2508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0424 -10.0758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3277 -10.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3283 -11.3096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0422 -11.7238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7572 -11.3103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7583 -10.4827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5204 -9.2305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5246 -10.0555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8096 -10.4661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8118 -11.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5266 -11.7002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2408 -11.2853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2402 -10.4576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 8 2 0
16 17 2 0
3 4 1 0
17 18 1 0
8 9 1 0
18 19 2 0
19 7 1 0
4 5 1 0
4 20 2 0
9 10 2 0
17 21 1 0
5 1 1 0
21 22 1 0
22 23 1 0
10 11 1 0
1 2 1 0
11 12 2 0
5 6 2 0
12 13 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
12 28 1 0
13 14 2 0
28 29 1 0
29 30 1 0
14 9 1 0
6 7 1 0
7 15 2 0
2 3 1 0
15 16 1 0
29 34 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.57Molecular Weight (Monoisotopic): 460.2250AlogP: 5.63#Rotatable Bonds: 6Polar Surface Area: 53.99Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.67CX LogD: 5.67Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.52Np Likeness Score: -0.07
References 1. Hu GX, Liang G, Chu Y, Li X, Lian QQ, Lin H, He Y, Huang Y, Hardy DO, Ge RS.. (2010) Curcumin derivatives inhibit testicular 17beta-hydroxysteroid dehydrogenase 3., 20 (8): [PMID:20346654 ] [10.1016/j.bmcl.2010.02.089 ]