The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-4-[3beta-Agammaetoxy-28-norlup-20(29)-en-17beta-yl]-2-butenolide ID: ALA1090340
PubChem CID: 46885646
Max Phase: Preclinical
Molecular Formula: C34H52O3
Molecular Weight: 508.79
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C(C)[C@@H]1CC[C@]2([C@H]3C=CC(=O)O3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](OC)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12
Standard InChI: InChI=1S/C34H52O3/c1-21(2)22-13-18-34(27-11-12-28(35)37-27)20-19-32(6)23(29(22)34)9-10-25-31(5)16-15-26(36-8)30(3,4)24(31)14-17-33(25,32)7/h11-12,22-27,29H,1,9-10,13-20H2,2-8H3/t22-,23+,24-,25+,26-,27+,29+,31-,32+,33+,34+/m0/s1
Standard InChI Key: NUYKRAQRSAIVEL-QNAGEJGSSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
26.2113 -9.0678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2072 -9.8888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9867 -10.1464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4726 -9.4847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9934 -8.8182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0637 -9.4655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3507 -9.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9243 -9.8635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5065 -8.6570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7935 -8.2299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0761 -8.6404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6375 -9.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9161 -10.6886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2029 -11.1031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9801 -7.4298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7686 -9.8801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3507 -10.6927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4941 -9.4903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1244 -8.1180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3631 -8.2175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2029 -9.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6417 -8.6197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6292 -11.1031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8051 -7.3551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4410 -6.8037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4940 -10.6886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4940 -9.8635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7064 -6.0283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0555 -10.2822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3423 -9.0426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9161 -9.0384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7884 -11.8038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4144 -11.8951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7809 -11.1031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.6284 -6.9654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7709 -8.9457 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
24.0839 -7.6404 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
23.9915 -7.6326 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
21.9161 -11.6886 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
28.2935 -9.4887 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0686 -10.6948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0173 -9.6597 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
7 6 1 0
8 12 1 0
9 18 1 6
10 11 1 0
11 6 1 0
12 7 1 0
13 23 1 0
14 13 1 0
15 10 1 0
9 1 1 0
16 6 1 0
17 7 1 0
18 16 1 0
19 9 1 0
20 11 1 0
21 8 1 0
22 20 1 0
23 17 1 0
24 15 1 0
15 25 1 6
26 14 1 0
27 21 1 0
28 25 2 0
6 29 1 6
7 30 1 1
8 31 1 1
14 32 1 0
33 14 1 0
26 34 1 1
35 25 1 0
12 36 1 6
11 37 1 1
10 38 1 6
13 39 1 6
10 9 1 0
12 22 1 0
19 24 1 0
8 13 1 0
27 26 1 0
4 5 1 0
4 40 2 0
1 5 1 0
34 41 1 0
1 42 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.79Molecular Weight (Monoisotopic): 508.3916AlogP: 8.14#Rotatable Bonds: 3Polar Surface Area: 35.53Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.66CX Basic pKa: ┄CX LogP: 7.93CX LogD: 7.93Aromatic Rings: ┄Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: 2.91
References 1. Csuk R, Barthel A, Schwarz S, Kommera H, Paschke R.. (2010) Synthesis and biological evaluation of antitumor-active gamma-butyrolactone substituted betulin derivatives., 18 (7): [PMID:20299226 ] [10.1016/j.bmc.2010.02.042 ]