The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[4-(N-Methyl-N-[(3-methylfuroxan-4-yl)methyl]-1-hydroxybutylidene]bis(phosphonic) acid ID: ALA1090497
PubChem CID: 46885774
Max Phase: Preclinical
Molecular Formula: C9H19N3O9P2
Molecular Weight: 375.21
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(CN(C)CCCC(O)(P(=O)(O)O)P(=O)(O)O)no[n+]1[O-]
Standard InChI: InChI=1S/C9H19N3O9P2/c1-7-8(10-21-12(7)14)6-11(2)5-3-4-9(13,22(15,16)17)23(18,19)20/h13H,3-6H2,1-2H3,(H2,15,16,17)(H2,18,19,20)
Standard InChI Key: GETLTRHZHJUCEZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
23 23 0 0 0 0 0 0 0 0999 V2000
10.5031 -12.1190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1860 -12.5820 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8386 -12.0770 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5578 -11.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7341 -11.3283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2273 -10.6773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0197 -10.6148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8427 -10.6730 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3046 -9.9894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2037 -11.4148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0267 -11.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3877 -12.2148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2107 -12.2731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5717 -13.0149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6726 -11.5895 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
16.0333 -12.2708 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
16.4417 -12.9833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7458 -11.8542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8292 -12.4833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0833 -11.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6667 -10.7625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3833 -11.1708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9125 -12.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
11 12 1 0
5 6 1 0
12 13 1 0
13 14 1 0
4 7 1 0
13 15 1 0
2 3 1 0
13 16 1 0
7 8 1 0
16 17 2 0
3 4 2 0
16 18 1 0
8 9 1 0
16 19 1 0
4 5 1 0
15 20 2 0
8 10 1 0
15 21 1 0
5 1 2 0
15 22 1 0
10 11 1 0
1 23 1 0
M CHG 2 1 1 23 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 375.21Molecular Weight (Monoisotopic): 375.0597AlogP: -1.17#Rotatable Bonds: 8Polar Surface Area: 191.50Molecular Species: ACIDHBA: 7HBD: 5#RO5 Violations: ┄HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 0.69CX Basic pKa: 6.09CX LogP: -6.27CX LogD: -9.12Aromatic Rings: 1Heavy Atoms: 23QED Weighted: 0.27Np Likeness Score: -0.43
References 1. Lolli ML, Rolando B, Tosco P, Chaurasia S, Di Stilo A, Lazzarato L, Gorassini E, Ferracini R, Oliaro-Bosso S, Fruttero R, Gasco A.. (2010) Synthesis and preliminary pharmacological characterisation of a new class of nitrogen-containing bisphosphonates (N-BPs)., 18 (7): [PMID:20299227 ] [10.1016/j.bmc.2010.02.058 ]