The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-(2-(1-(2-(1-(3-methylbenzoyl)piperidin-4-yl)ethyl)pyrrolidin-3-ylamino)-2-oxoethyl)-3-(trifluoromethyl)benzamide ID: ALA1090548
PubChem CID: 46842086
Max Phase: Preclinical
Molecular Formula: C29H35F3N4O3
Molecular Weight: 544.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc(C(=O)N2CCC(CCN3CC[C@@H](NC(=O)CNC(=O)c4cccc(C(F)(F)F)c4)C3)CC2)c1
Standard InChI: InChI=1S/C29H35F3N4O3/c1-20-4-2-6-23(16-20)28(39)36-14-9-21(10-15-36)8-12-35-13-11-25(19-35)34-26(37)18-33-27(38)22-5-3-7-24(17-22)29(30,31)32/h2-7,16-17,21,25H,8-15,18-19H2,1H3,(H,33,38)(H,34,37)/t25-/m1/s1
Standard InChI Key: VVWKTZGDVFHHDW-RUZDIDTESA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
11.0673 -10.2392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0660 -11.0669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7790 -11.4797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4983 -11.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4951 -10.2353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7771 -9.8264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2061 -9.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9249 -10.2293 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.2027 -8.9948 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.9198 -9.4005 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.3500 -9.8270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3498 -9.0019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6375 -10.2396 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9248 -9.8273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2077 -10.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4950 -9.8277 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2080 -11.0650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7781 -10.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9989 -9.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5213 -10.6644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0143 -11.3272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7955 -11.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6964 -10.6767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2732 -9.9658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4483 -9.9781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0256 -9.2646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2045 -9.2748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7985 -9.9914 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2204 -10.6998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0482 -10.6961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9735 -10.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5688 -10.7174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5533 -9.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9594 -8.5721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5445 -7.8599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2814 -7.8684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6905 -8.5909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2685 -9.2997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5155 -8.6030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 5 1 0
7 10 1 0
2 3 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 18 1 0
1 11 1 0
20 23 1 0
5 6 2 0
23 24 1 0
11 12 2 0
24 25 1 0
25 26 1 0
6 1 1 0
11 13 1 0
1 2 2 0
13 14 1 0
5 7 1 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
14 15 1 0
28 31 1 0
3 4 2 0
31 32 2 0
15 16 1 0
31 33 1 0
7 8 1 0
33 34 2 0
15 17 2 0
34 35 1 0
35 36 2 0
18 16 1 6
36 37 1 0
18 19 1 0
37 38 2 0
38 33 1 0
7 9 1 0
37 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 544.62Molecular Weight (Monoisotopic): 544.2661AlogP: 3.88#Rotatable Bonds: 8Polar Surface Area: 81.75Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.01CX LogP: 3.24CX LogD: 1.62Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.53Np Likeness Score: -1.85
References 1. Lim JW, Oh Y, Kim JH, Oak MH, Na Y, Lee JO, Lee SW, Cho H, Park WK, Choi G, Kang J.. (2010) Synthesis and biological evaluation of 3-aminopyrrolidine derivatives as CC chemokine receptor 2 antagonists., 20 (7): [PMID:20223662 ] [10.1016/j.bmcl.2010.02.072 ]