The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,3-bis(4-(5-(trifluoromethyl)-1H-benzo[d]imidazol-2-yl)phenyl)urea ID: ALA1090692
PubChem CID: 46886358
Max Phase: Preclinical
Molecular Formula: C29H18F6N6O
Molecular Weight: 580.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(-c2nc3cc(C(F)(F)F)ccc3[nH]2)cc1)Nc1ccc(-c2nc3cc(C(F)(F)F)ccc3[nH]2)cc1
Standard InChI: InChI=1S/C29H18F6N6O/c30-28(31,32)17-5-11-21-23(13-17)40-25(38-21)15-1-7-19(8-2-15)36-27(42)37-20-9-3-16(4-10-20)26-39-22-12-6-18(29(33,34)35)14-24(22)41-26/h1-14H,(H,38,40)(H,39,41)(H2,36,37,42)
Standard InChI Key: XDRITBUGCUCJPA-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
4.6075 -1.2836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0166 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8427 -2.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2517 -2.7197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8346 -3.4327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0085 -3.4295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5994 -2.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2437 -4.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9062 -4.9000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5149 -5.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2312 -5.0469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0618 -4.2402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5116 -6.2821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2247 -6.6992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9411 -6.2901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9444 -5.4640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6263 -0.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6274 -0.9897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9126 -1.4026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9144 0.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1991 -0.1588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1989 -0.9898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4085 -1.2464 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0798 -0.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4089 0.0982 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9015 -0.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3136 -1.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1377 -1.2882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5508 -0.5731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1336 0.1436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3109 0.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3757 -0.5717 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3407 0.2499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3409 1.0748 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.0551 -0.1628 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.0581 0.6624 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.7894 -1.2854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3782 -2.0004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2204 -7.5241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5039 -7.9329 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.9327 -7.9403 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.2161 -8.3451 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 1 0
8 12 1 0
13 14 1 0
14 15 2 0
15 16 1 0
11 16 2 0
10 13 2 0
5 8 1 0
1 2 1 0
20 17 1 0
21 22 1 0
26 27 2 0
27 28 1 0
18 19 1 0
28 29 2 0
19 22 2 0
29 30 1 0
17 18 2 0
30 31 2 0
31 26 1 0
24 26 1 0
21 20 2 0
29 32 1 0
22 23 1 0
17 33 1 0
23 24 1 0
33 34 1 0
24 25 2 0
33 35 1 0
25 21 1 0
33 36 1 0
2 3 1 0
32 37 1 0
37 1 1 0
3 4 2 0
37 38 2 0
4 5 1 0
14 39 1 0
5 6 2 0
39 40 1 0
6 7 1 0
39 41 1 0
2 7 2 0
39 42 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 580.49Molecular Weight (Monoisotopic): 580.1446AlogP: 8.45#Rotatable Bonds: 4Polar Surface Area: 98.49Molecular Species: NEUTRALHBA: 3HBD: 4#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.90CX Basic pKa: 5.25CX LogP: 7.50CX LogD: 7.49Aromatic Rings: 6Heavy Atoms: 42QED Weighted: 0.16Np Likeness Score: -1.00
References 1. Tonelli M, Simone M, Tasso B, Novelli F, Boido V, Sparatore F, Paglietti G, Pricl S, Giliberti G, Blois S, Ibba C, Sanna G, Loddo R, La Colla P.. (2010) Antiviral activity of benzimidazole derivatives. II. Antiviral activity of 2-phenylbenzimidazole derivatives., 18 (8): [PMID:20359898 ] [10.1016/j.bmc.2010.02.037 ]