4-Pregnen-21-ol-3,20-dione-21-(4-fluorobenzenesufonate)

ID: ALA1090768

PubChem CID: 44550020

Max Phase: Preclinical

Molecular Formula: C27H33FO5S

Molecular Weight: 488.62

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)COS(=O)(=O)c1ccc(F)cc1

Standard InChI:  InChI=1S/C27H33FO5S/c1-26-13-11-19(29)15-17(26)3-8-21-22-9-10-24(27(22,2)14-12-23(21)26)25(30)16-33-34(31,32)20-6-4-18(28)5-7-20/h4-7,15,21-24H,3,8-14,16H2,1-2H3/t21-,22-,23-,24+,26-,27-/m0/s1

Standard InChI Key:  SEFFBWPLJDIEFM-YNHSGCSHSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   -4.7105  -17.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7105  -16.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9988  -15.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9988  -17.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2829  -17.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5671  -17.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8512  -17.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8512  -16.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1395  -15.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3549  -16.1571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1299  -15.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3552  -14.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0576  -14.1077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8819  -14.1046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1395  -15.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1395  -14.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8512  -14.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5671  -15.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5671  -15.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2829  -16.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2829  -15.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5671  -16.7250    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8512  -15.4875    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1395  -16.7250    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4253  -17.5494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3562  -13.3940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2916  -13.3887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1156  -13.4290    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.9390  -13.4200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1000  -14.2539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1328  -12.6042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3567  -14.1309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1794  -14.1223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5841  -13.4041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1601  -12.6932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3389  -12.7053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4091  -13.3939    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
 13 14  1  0
 12 15  1  0
  9 15  1  0
 15 16  1  1
 15 17  1  0
 17 18  1  0
 18 19  1  0
  8 19  1  0
 19 20  1  0
  3 20  1  0
  5 20  1  0
 20 21  1  1
 19 22  1  6
  8 23  1  1
  9 24  1  6
  1 25  2  0
  1  2  1  0
 13 26  2  0
  2  3  1  0
 14 27  1  0
  1  4  1  0
 27 28  1  0
  4  5  2  0
 28 29  1  0
  5  6  1  0
 28 30  2  0
  6  7  1  0
 28 31  2  0
  7  8  1  0
 29 32  2  0
  8  9  1  0
 32 33  1  0
  9 10  1  0
 33 34  2  0
 10 11  1  0
 34 35  1  0
 11 12  1  0
 35 36  2  0
 36 29  1  0
 12 13  1  1
 34 37  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA1090768

   [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-fluorobenzenesulfonate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 488.62

Molecular Weight (Monoisotopic): 488.2033

AlogP: 5.25

#Rotatable Bonds: 5

Polar Surface Area: 77.51

Molecular Species: NEUTRAL

HBA: 5

HBD: ┄

#RO5 Violations: 1

HBA (Lipinski): 5

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): 1

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 5.52

CX LogD: 5.52

Aromatic Rings: 1

Heavy Atoms: 34

QED Weighted: 0.53

Np Likeness Score: 0.96

References

1. Dexheimer TS, Gediya LK, Stephen AG, Weidlich I, Antony S, Marchand C, Interthal H, Nicklaus M, Fisher RJ, Njar VC, Pommier Y..  (2009)  4-Pregnen-21-ol-3,20-dione-21-(4-bromobenzenesulfonate) (NSC 88915) and related novel steroid derivatives as tyrosyl-DNA phosphodiesterase (Tdp1) inhibitors.,  52  (22): [PMID:19883083] [10.1021/jm901061s]

Source

Source(1):

• Scientific Literature