4-Pregnen-21-ol-3,20-dione-21-(4-chlorobenzenesufonate)

ID: ALA1090769

PubChem CID: 44550021

Max Phase: Preclinical

Molecular Formula: C27H33ClO5S

Molecular Weight: 505.08

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)COS(=O)(=O)c1ccc(Cl)cc1

Standard InChI:  InChI=1S/C27H33ClO5S/c1-26-13-11-19(29)15-17(26)3-8-21-22-9-10-24(27(22,2)14-12-23(21)26)25(30)16-33-34(31,32)20-6-4-18(28)5-7-20/h4-7,15,21-24H,3,8-14,16H2,1-2H3/t21-,22-,23-,24+,26-,27-/m0/s1

Standard InChI Key:  ZCTDOVUGXPVSMJ-YNHSGCSHSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    6.5895  -16.6709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5895  -15.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3012  -15.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3012  -17.0834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0171  -16.6709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7329  -17.0834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4488  -16.6709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4488  -15.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1605  -15.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9451  -15.6905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4299  -15.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9448  -14.3561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3576  -13.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1819  -13.6379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1605  -14.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1605  -13.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4488  -14.1959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7329  -14.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7329  -15.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0171  -15.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0171  -15.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7329  -16.2584    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.4488  -15.0209    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.1605  -16.2584    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8747  -17.0828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9438  -12.9273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5916  -12.9221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4156  -12.9623    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.2390  -12.9533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4000  -13.7872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4328  -12.1375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6567  -13.6643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4794  -13.6556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8841  -12.9374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4601  -12.2265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6389  -12.2387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7091  -12.9273    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
 13 14  1  0
 12 15  1  0
  9 15  1  0
 15 16  1  1
 15 17  1  0
 17 18  1  0
 18 19  1  0
  8 19  1  0
 19 20  1  0
  3 20  1  0
  5 20  1  0
 20 21  1  1
 19 22  1  6
  8 23  1  1
  9 24  1  6
  1 25  2  0
  1  2  1  0
 13 26  2  0
  2  3  1  0
 14 27  1  0
  1  4  1  0
 27 28  1  0
  4  5  2  0
 28 29  1  0
  5  6  1  0
 28 30  2  0
  6  7  1  0
 28 31  2  0
  7  8  1  0
 29 32  2  0
  8  9  1  0
 32 33  1  0
  9 10  1  0
 33 34  2  0
 10 11  1  0
 34 35  1  0
 11 12  1  0
 35 36  2  0
 36 29  1  0
 12 13  1  1
 34 37  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA1090769

   [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-chlorobenzenesulfonate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 505.08

Molecular Weight (Monoisotopic): 504.1737

AlogP: 5.76

#Rotatable Bonds: 5

Polar Surface Area: 77.51

Molecular Species: NEUTRAL

HBA: 5

HBD: ┄

#RO5 Violations: 2

HBA (Lipinski): 5

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): 2

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 5.99

CX LogD: 5.99

Aromatic Rings: 1

Heavy Atoms: 34

QED Weighted: 0.48

Np Likeness Score: 1.03

References

1. Dexheimer TS, Gediya LK, Stephen AG, Weidlich I, Antony S, Marchand C, Interthal H, Nicklaus M, Fisher RJ, Njar VC, Pommier Y..  (2009)  4-Pregnen-21-ol-3,20-dione-21-(4-bromobenzenesulfonate) (NSC 88915) and related novel steroid derivatives as tyrosyl-DNA phosphodiesterase (Tdp1) inhibitors.,  52  (22): [PMID:19883083] [10.1021/jm901061s]

Source

Source(1):

• Scientific Literature