The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1S)-1,5-Anhydro-1-[4-chloro-5-(4-ethylbenzyl)-2-methoxyphenyl]-1-thio-D-glucitol ID: ALA1090786
PubChem CID: 46205462
Max Phase: Preclinical
Molecular Formula: C22H27ClO5S
Molecular Weight: 438.97
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccc(Cc2cc([C@@H]3S[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(OC)cc2Cl)cc1
Standard InChI: InChI=1S/C22H27ClO5S/c1-3-12-4-6-13(7-5-12)8-14-9-15(17(28-2)10-16(14)23)22-21(27)20(26)19(25)18(11-24)29-22/h4-7,9-10,18-22,24-27H,3,8,11H2,1-2H3/t18-,19-,20+,21-,22+/m1/s1
Standard InChI Key: ZCUPHXMNGVNWAQ-BDHVOXNPSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
8.9557 -16.2613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9557 -17.0909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6701 -17.5034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3892 -17.0909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3892 -16.2613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6701 -15.8443 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.1041 -15.8496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8155 -16.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5283 -15.8593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5334 -15.0340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8195 -14.6186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1006 -15.0285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2408 -16.2752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9572 -15.8661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6659 -16.2843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3818 -15.8760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3862 -15.0501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6688 -14.6344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9558 -15.0451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2402 -15.8506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5267 -16.2649 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2412 -17.5034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6689 -18.3284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1031 -17.5044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1021 -14.6401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8152 -15.0551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3863 -14.6155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3869 -13.7906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2498 -14.6249 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
13 14 1 0
5 7 1 1
14 15 2 0
7 8 1 0
15 16 1 0
1 2 1 0
16 17 2 0
1 6 1 0
17 18 1 0
2 3 1 0
18 19 2 0
19 14 1 0
3 4 1 0
1 20 1 1
4 5 1 0
20 21 1 0
7 12 2 0
2 22 1 6
8 9 2 0
3 23 1 1
9 10 1 0
4 24 1 6
10 11 2 0
17 25 1 0
11 12 1 0
25 26 1 0
5 6 1 0
12 27 1 0
9 13 1 0
27 28 1 0
10 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.97Molecular Weight (Monoisotopic): 438.1268AlogP: 2.73#Rotatable Bonds: 6Polar Surface Area: 90.15Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.85CX Basic pKa: ┄CX LogP: 3.13CX LogD: 3.13Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.55Np Likeness Score: 0.14
References 1. Kakinuma H, Oi T, Hashimoto-Tsuchiya Y, Arai M, Kawakita Y, Fukasawa Y, Iida I, Hagima N, Takeuchi H, Chino Y, Asami J, Okumura-Kitajima L, Io F, Yamamoto D, Miyata N, Takahashi T, Uchida S, Yamamoto K.. (2010) (1S)-1,5-anhydro-1-[5-(4-ethoxybenzyl)-2-methoxy-4-methylphenyl]-1-thio-D-glucitol (TS-071) is a potent, selective sodium-dependent glucose cotransporter 2 (SGLT2) inhibitor for type 2 diabetes treatment., 53 (8): [PMID:20302302 ] [10.1021/jm901893x ]