(S)-2-amino-3-(4-(2-(biphenyl-4-yl)ethoxy)-2-(trifluoromethyl)phenylamino)-2-methyl-3-oxopropyl dihydrogen phosphate

ID: ALA1090828

PubChem CID: 46885797

Max Phase: Preclinical

Molecular Formula: C25H26F3N2O6P

Molecular Weight: 538.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@](N)(COP(=O)(O)O)C(=O)Nc1ccc(OCCc2ccc(-c3ccccc3)cc2)cc1C(F)(F)F

Standard InChI:  InChI=1S/C25H26F3N2O6P/c1-24(29,16-36-37(32,33)34)23(31)30-22-12-11-20(15-21(22)25(26,27)28)35-14-13-17-7-9-19(10-8-17)18-5-3-2-4-6-18/h2-12,15H,13-14,16,29H2,1H3,(H,30,31)(H2,32,33,34)/t24-/m0/s1

Standard InChI Key:  YMBOZHBXRGFOHL-DEOSSOPVSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   16.1694  -27.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1682  -27.9148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8831  -28.3277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5995  -27.9144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5966  -27.0838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8813  -26.6747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3096  -26.6686    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0256  -27.0784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7385  -26.6633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0287  -27.9034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4545  -27.0731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1674  -26.6579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1500  -26.0750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.3208  -26.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4534  -28.3268    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7393  -27.9137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0245  -28.3256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3104  -27.9126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3158  -27.0866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6025  -26.6736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8867  -27.0856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8887  -27.9148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6026  -28.3241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1705  -26.6761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1714  -25.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4576  -25.4380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7493  -25.8509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7462  -26.6802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4599  -27.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8834  -27.0677    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   22.5964  -26.6525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.8865  -27.8927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.6669  -26.2716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8788  -25.8497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5920  -25.4351    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.1631  -25.4393    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.8708  -25.0208    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  8  9  1  0
 18 19  2  0
  4  5  1  0
 19 20  1  0
  8 10  2  0
 20 21  2  0
  2  3  1  0
 21 22  1  0
  9 11  1  0
 22 23  2  0
 23 18  1  0
  5  6  2  0
 11 12  1  0
 24 25  2  0
  6  1  1  0
 25 26  1  0
  9 13  1  1
 26 27  2  0
  1  2  2  0
 27 28  1  0
  9 14  1  0
 28 29  2  0
 29 24  1  0
 21 24  1  0
  5  7  1  0
 12 30  1  0
  2 15  1  0
 30 31  2  0
  3  4  2  0
 30 32  1  0
 15 16  1  0
 30 33  1  0
  7  8  1  0
  6 34  1  0
 16 17  1  0
 34 35  1  0
 34 36  1  0
 17 18  1  0
 34 37  1  0
M  END

Associated Targets(Human)

S1PR1 Tclin Sphingosine 1-phosphate receptor Edg-1 (5806 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
S1PR3 Tclin Sphingosine 1-phosphate receptor Edg-3 (2543 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 538.46Molecular Weight (Monoisotopic): 538.1481AlogP: 4.76#Rotatable Bonds: 10
Polar Surface Area: 131.11Molecular Species: ACIDHBA: 5HBD: 4
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 1.48CX Basic pKa: 8.41CX LogP: 3.49CX LogD: 2.52
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.27Np Likeness Score: -0.54

References

1. Evindar G, Bernier SG, Doyle E, Kavarana MJ, Satz AL, Lorusso J, Blanchette HS, Saha AK, Hannig G, Morgan BA, Westlin WF..  (2010)  Exploration of amino alcohol derivatives as novel, potent, and highly selective sphingosine-1-phosphate receptor subtype-1 agonists.,  20  (8): [PMID:20304639] [10.1016/j.bmcl.2010.02.098]

Source