(S)-1-((3'-methyl-2',5'-dioxo-6,8-dihydrospiro[cyclopenta[g]quinoline-7,4'-imidazolidine]-2-yl)methyl)-1H-imidazo[1,5,4-de]quinoxaline-2,5(4H,6H)-dione

ID: ALA1090848

PubChem CID: 46885135

Max Phase: Preclinical

Molecular Formula: C25H20N6O4

Molecular Weight: 468.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1C(=O)NC(=O)[C@@]12Cc1cc3ccc(Cn4c(=O)n5c6c(cccc64)NC(=O)C5)nc3cc1C2

Standard InChI:  InChI=1S/C25H20N6O4/c1-29-23(34)28-22(33)25(29)9-14-7-13-5-6-16(26-18(13)8-15(14)10-25)11-30-19-4-2-3-17-21(19)31(24(30)35)12-20(32)27-17/h2-8H,9-12H2,1H3,(H,27,32)(H,28,33,34)/t25-/m0/s1

Standard InChI Key:  NIDRSUIUJBMPLL-VWLOTQADSA-N

Molfile:  

     RDKit          2D

 35 41  0  0  0  0  0  0  0  0999 V2000
   18.7199   -7.5214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2425   -8.1599    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0113   -7.8602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9639   -7.0365    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1658   -6.8272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7042   -8.2473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7789   -6.5987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4777   -7.0454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4362   -7.8665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2042   -8.1598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2715   -6.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8661   -6.0583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7056   -8.3061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0331   -8.9580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0130   -7.7988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0449   -6.9823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5947   -7.8670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1256   -8.4891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1244   -9.3165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8394   -9.7295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5560   -9.3161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5542   -8.4908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1693   -7.9375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8340   -7.1806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2471   -6.4663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9041   -8.3129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3229   -8.2440    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2361   -6.6022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5491   -7.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8376   -8.0762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0143   -7.2703    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4081   -6.7175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6217   -6.9651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4451   -7.7708    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0129   -6.4082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  7 16  2  0
  8  9  2  0
  2  3  1  0
 18 19  2  0
  3  4  1  0
 19 20  1  0
  4  5  1  0
 20 21  2  0
 21 22  1  0
 30 18  1  0
 30 22  2  0
  1  5  1  1
  9 10  1  0
 10  1  1  0
 22 23  1  0
 23 24  1  0
 24 31  1  0
  1 11  1  0
 24 25  2  0
 11  8  1  0
 23 26  1  0
 26 17  1  0
  2  1  1  0
 17 27  2  0
 27 15  1  0
  5 12  2  0
 16 28  1  0
 15  6  2  0
 28 29  2  0
 29 17  1  0
 30 31  1  0
  3 13  2  0
  6  9  1  0
  2 14  1  0
 15 16  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 18  1  0
  8  7  1  0
 33 35  2  0
M  END

Associated Targets(Human)

CALCRL Tclin Calcitonin gene-related peptide type 1 receptor (1509 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.47Molecular Weight (Monoisotopic): 468.1546AlogP: 1.37#Rotatable Bonds: 2
Polar Surface Area: 118.33Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.45CX Basic pKa: 3.17CX LogP: 1.28CX LogD: 1.28
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.43Np Likeness Score: -0.59

References

1. Stump CA, Bell IM, Bednar RA, Fay JF, Gallicchio SN, Hershey JC, Jelley R, Kreatsoulas C, Moore EL, Mosser SD, Quigley AG, Roller SA, Salvatore CA, Sharik SS, Theberge CR, Zartman CB, Kane SA, Graham SL, Selnick HG, Vacca JP, Williams TM..  (2010)  Identification of potent, highly constrained CGRP receptor antagonists.,  20  (8): [PMID:20299218] [10.1016/j.bmcl.2010.02.086]

Source