(S)-2-(methylamino)-N-((S)-2-((S)-2-(4-(naphthalen-1-yl)thiazol-2-yl)pyrrolidin-1-yl)-2-oxo-1-(tetrahydro-2H-pyran-4-yl)ethyl)propanamide

ID: ALA1091045

PubChem CID: 46884435

Max Phase: Preclinical

Molecular Formula: C28H34N4O3S

Molecular Weight: 506.67

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN[C@@H](C)C(=O)N[C@H](C(=O)N1CCC[C@H]1c1nc(-c2cccc3ccccc23)cs1)C1CCOCC1

Standard InChI:  InChI=1S/C28H34N4O3S/c1-18(29-2)26(33)31-25(20-12-15-35-16-13-20)28(34)32-14-6-11-24(32)27-30-23(17-36-27)22-10-5-8-19-7-3-4-9-21(19)22/h3-5,7-10,17-18,20,24-25,29H,6,11-16H2,1-2H3,(H,31,33)/t18-,24-,25-/m0/s1

Standard InChI Key:  YXGUDIMUDRFJGV-WDNCENIBSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   -3.4241   -8.3702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7088   -8.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4241   -7.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9933   -8.3702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7088   -9.6063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2780   -8.7808    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9933   -7.5449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5625   -8.3702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1528   -8.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5625   -7.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1528   -9.6063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8641   -8.3702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6171   -8.7037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1708   -8.0934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7601   -7.3779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9527   -7.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7919   -9.5111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2387  -10.1256    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.6493  -10.8411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4568  -10.6702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5425   -9.8494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1669  -11.0835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8808  -10.6765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5945  -11.0904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5923  -11.9183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8750  -12.3276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1640  -11.9075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4469  -12.3131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4394  -13.1386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1550  -13.5569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8694  -13.1488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1509   -7.1371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1529   -6.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5601   -5.8988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2767   -6.3102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2804   -7.1382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  8  9  1  0
  2  5  1  6
  8 10  1  1
  1  3  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 17  2  0
  9 11  2  0
 22 27  2  0
 26 25  2  0
  4  6  1  0
 24 23  2  0
 23 22  1  0
 20 22  1  0
  9 12  1  0
 12 13  1  0
 24 25  1  0
  1  2  1  0
  4  7  2  0
 26 27  1  0
  2  4  1  0
 27 28  1  0
  6  8  1  0
 28 29  2  0
 13 14  1  0
 29 30  1  0
 14 15  1  0
 30 31  2  0
 31 26  1  0
 10 32  1  0
 15 16  1  0
 16 12  1  0
 13 17  1  1
 17 18  1  0
 10 36  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
M  END

Associated Targets(Human)

XIAP Tchem Inhibitor of apoptosis protein 3 (3673 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BIRC7 Tchem Baculoviral IAP repeat-containing protein 7 (64 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.67Molecular Weight (Monoisotopic): 506.2352AlogP: 4.15#Rotatable Bonds: 7
Polar Surface Area: 83.56Molecular Species: BASEHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.42CX Basic pKa: 8.60CX LogP: 3.12CX LogD: 1.89
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.50Np Likeness Score: -0.54

References

1. Cohen F, Koehler MF, Bergeron P, Elliott LO, Flygare JA, Franklin MC, Gazzard L, Keteltas SF, Lau K, Ly CQ, Tsui V, Fairbrother WJ..  (2010)  Antagonists of inhibitor of apoptosis proteins based on thiazole amide isosteres.,  20  (7): [PMID:20189383] [10.1016/j.bmcl.2010.02.021]

Source