(+/-)-tert-butyl 2-((R)-1-((1S,2R)-2-(4-(methylthio)benzamido)cyclohexyl)-2-oxopyrrolidin-3-ylcarbamoyl)-4-(trifluoromethyl)phenylcarbamate

ID: ALA1091266

PubChem CID: 46886507

Max Phase: Preclinical

Molecular Formula: C29H37F3N4O4S

Molecular Weight: 594.70

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CSc1ccc(CN[C@@H]2CCCC[C@@H]2NC(=O)CNC(=O)c2cc(C(F)(F)F)ccc2NC(=O)OC(C)(C)C)cc1

Standard InChI:  InChI=1S/C29H37F3N4O4S/c1-28(2,3)40-27(39)36-22-14-11-19(29(30,31)32)15-21(22)26(38)34-17-25(37)35-24-8-6-5-7-23(24)33-16-18-9-12-20(41-4)13-10-18/h9-15,23-24,33H,5-8,16-17H2,1-4H3,(H,34,38)(H,35,37)(H,36,39)/t23-,24+/m1/s1

Standard InChI Key:  LGCMOVRCUKEIRN-RPWUZVMVSA-N

Molfile:  

     RDKit          2D

 41 43  0  0  0  0  0  0  0  0999 V2000
    9.9486   -0.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9474   -1.5982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6622   -2.0110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3787   -1.5977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3758   -0.7672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6604   -0.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2340   -0.3585    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.2338    0.4665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0938   -2.0091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8076   -1.5954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8063   -0.7704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5235   -0.3599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5242    0.4615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8109    0.8768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0952    0.4644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0929   -0.3633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2370   -0.7740    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.9524   -0.3631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6660   -0.7772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9543    0.4619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3814   -0.3663    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0949   -0.7804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8103   -0.3695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0931   -1.6054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5199   -0.7869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2348   -0.3767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2371    0.4492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5186    0.8632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8066    0.4506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5175    1.6882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2315    2.1016    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.8025    2.0998    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.5125    2.5167    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.5155   -1.6119    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2278   -2.0282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2233   -2.8532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9444   -1.6195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6567   -2.0358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3733   -1.6272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6523   -2.8608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3667   -2.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 18 20  2  0
  9 10  1  0
 19 21  1  0
  2  3  1  0
 21 22  1  0
 11 10  1  6
 22 23  1  0
 11 12  1  0
 22 24  2  0
  5  6  2  0
 23 25  2  0
  6  1  1  0
 25 26  1  0
  1  2  2  0
 26 27  2  0
  1  7  1  0
 27 28  1  0
  3  4  2  0
 28 29  2  0
 29 23  1  0
 11 16  1  0
 28 30  1  0
 12 13  1  0
 30 31  1  0
 13 14  1  0
 30 32  1  0
 14 15  1  0
 30 33  1  0
 15 16  1  0
 25 34  1  0
  7  8  1  0
 34 35  1  0
 12 17  1  6
 35 36  2  0
 35 37  1  0
 17 18  1  0
 37 38  1  0
  4  9  1  0
 38 39  1  0
 18 19  1  0
 38 40  1  0
  4  5  1  0
 38 41  1  0
M  END

Associated Targets(Human)

CCR2 Tchem C-C chemokine receptor type 2 (5628 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 594.70Molecular Weight (Monoisotopic): 594.2488AlogP: 5.72#Rotatable Bonds: 9
Polar Surface Area: 108.56Molecular Species: BASEHBA: 6HBD: 4
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.24CX Basic pKa: 8.96CX LogP: 5.13CX LogD: 3.57
Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.28Np Likeness Score: -1.40

References

1. Cherney RJ, Mo R, Meyer DT, Voss ME, Yang MG, Santella JB, Duncia JV, Lo YC, Yang G, Miller PB, Scherle PA, Zhao Q, Mandlekar S, Cvijic ME, Barrish JC, Decicco CP, Carter PH..  (2010)  gamma-Lactams as glycinamide replacements in cyclohexane-based CC chemokine receptor 2 (CCR2) antagonists.,  20  (8): [PMID:20346664] [10.1016/j.bmcl.2010.03.035]

Source