The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-((S)-1-cyclohexyl-2-oxo-2-((S)-2-(4-phenylthiazolo[4,5-c]pyridin-2-yl)pyrrolidin-1-yl)ethyl)-2-(methylamino)propanamide ID: ALA1091453
PubChem CID: 46884085
Max Phase: Preclinical
Molecular Formula: C28H35N5O2S
Molecular Weight: 505.69
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN[C@@H](C)C(=O)N[C@H](C(=O)N1CCC[C@H]1c1nc2c(-c3ccccc3)nccc2s1)C1CCCCC1
Standard InChI: InChI=1S/C28H35N5O2S/c1-18(29-2)26(34)31-24(20-12-7-4-8-13-20)28(35)33-17-9-14-21(33)27-32-25-22(36-27)15-16-30-23(25)19-10-5-3-6-11-19/h3,5-6,10-11,15-16,18,20-21,24,29H,4,7-9,12-14,17H2,1-2H3,(H,31,34)/t18-,21-,24-/m0/s1
Standard InChI Key: DAXYGNXUBMFNHC-XZOYJPPVSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
7.9052 -0.8837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6207 -1.2944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9052 -0.0580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3362 -0.8837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6207 -2.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0518 -1.2944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3362 -0.0580 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7673 -0.8837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4829 -1.2944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7673 -0.0580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4829 -2.1200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1942 -0.8837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9474 -1.2172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5012 -0.6068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0905 0.1088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2829 -0.0620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1224 -2.0248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5690 -2.6395 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.8731 -2.3631 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4810 0.3498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4830 1.1717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7698 1.5884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0530 1.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0493 0.3486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7874 -3.1842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9800 -3.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7247 -4.1365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2759 -4.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0855 -4.5758 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3370 -3.7934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1401 -3.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6863 -4.2315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4887 -4.0596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7416 -3.2772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1859 -2.6664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3856 -2.8416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8 9 1 0
2 5 1 6
18 26 1 0
25 19 1 0
19 17 2 0
10 20 1 0
8 10 1 1
1 3 1 0
9 11 2 0
4 6 1 0
9 12 1 0
10 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
12 13 1 0
1 2 1 0
25 26 2 0
4 7 2 0
26 27 1 0
2 4 1 0
27 28 2 0
6 8 1 0
28 29 1 0
13 14 1 0
29 30 2 0
30 25 1 0
14 15 1 0
30 31 1 0
15 16 1 0
31 32 2 0
16 12 1 0
32 33 1 0
33 34 2 0
13 17 1 1
34 35 1 0
17 18 1 0
35 36 2 0
36 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.69Molecular Weight (Monoisotopic): 505.2511AlogP: 4.69#Rotatable Bonds: 7Polar Surface Area: 87.22Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.41CX Basic pKa: 8.60CX LogP: 4.09CX LogD: 2.86Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.49Np Likeness Score: -0.64
References 1. Cohen F, Koehler MF, Bergeron P, Elliott LO, Flygare JA, Franklin MC, Gazzard L, Keteltas SF, Lau K, Ly CQ, Tsui V, Fairbrother WJ.. (2010) Antagonists of inhibitor of apoptosis proteins based on thiazole amide isosteres., 20 (7): [PMID:20189383 ] [10.1016/j.bmcl.2010.02.021 ]