The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
arabinouridine-5'-[phenyl-(benzoxy-L-alaninyl)]-phosphate ID: ALA1091515
PubChem CID: 46885830
Max Phase: Preclinical
Molecular Formula: C25H28N3O10P
Molecular Weight: 561.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](O)[C@@H]1O)Oc1ccccc1)C(=O)OCc1ccccc1
Standard InChI: InChI=1S/C25H28N3O10P/c1-16(24(32)35-14-17-8-4-2-5-9-17)27-39(34,38-18-10-6-3-7-11-18)36-15-19-21(30)22(31)23(37-19)28-13-12-20(29)26-25(28)33/h2-13,16,19,21-23,30-31H,14-15H2,1H3,(H,27,34)(H,26,29,33)/t16-,19+,21+,22-,23+,39?/m0/s1
Standard InChI Key: DKBXRLMSQKUCCW-MUAVBWOBSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
14.7958 -8.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6208 -8.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8776 -7.9451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2083 -7.4583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5433 -7.9451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6633 -7.6911 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3738 -8.1044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0887 -7.6999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0982 -6.8746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3865 -6.4554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6653 -6.8615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3688 -8.9294 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1049 -9.3972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7585 -7.6905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3100 -9.3960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1457 -8.2428 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3609 -7.9882 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
11.5583 -7.7708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5961 -7.1974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1323 -8.7809 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5185 -6.9468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8168 -6.4694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2139 -6.5056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1744 -5.6824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4403 -5.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7444 -5.7550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7873 -6.5768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4249 -9.2037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4380 -10.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7039 -8.8026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7301 -10.4524 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1589 -10.4297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7432 -11.2773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0354 -11.7011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3164 -11.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6091 -11.7235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6218 -12.5493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3477 -12.9502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0521 -12.5248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17 19 2 0
6 11 1 0
17 20 1 0
7 8 1 0
18 21 1 0
8 9 1 0
9 22 2 0
9 10 1 0
21 23 2 0
10 11 2 0
23 24 1 0
1 2 1 0
24 25 2 0
7 12 2 0
25 26 1 0
3 6 1 1
26 27 2 0
27 21 1 0
2 13 1 1
20 28 1 0
6 7 1 0
28 29 1 0
5 14 1 1
28 30 1 6
29 31 1 0
1 15 1 6
29 32 2 0
2 3 1 0
31 33 1 0
14 16 1 0
33 34 1 0
3 4 1 0
34 35 2 0
16 17 1 0
35 36 1 0
4 5 1 0
36 37 2 0
17 18 1 0
37 38 1 0
5 1 1 0
38 39 2 0
39 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 561.48Molecular Weight (Monoisotopic): 561.1512AlogP: 1.08#Rotatable Bonds: 11Polar Surface Area: 178.41Molecular Species: NEUTRALHBA: 11HBD: 4#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.59CX Basic pKa: ┄CX LogP: 1.06CX LogD: 1.06Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.19Np Likeness Score: 0.46
References 1. Mehellou Y, Valente R, Mottram H, Walsby E, Mills KI, Balzarini J, McGuigan C.. (2010) Phosphoramidates of 2'-beta-D-arabinouridine (AraU) as phosphate prodrugs; design, synthesis, in vitro activity and metabolism., 18 (7): [PMID:20299228 ] [10.1016/j.bmc.2010.02.059 ]