(S)-N-((S)-3,3-dimethyl-1-((S)-2-(4-(naphthalen-1-yl)thiazol-2-yl)pyrrolidin-1-yl)-1-oxobutan-2-yl)-2-(methylamino)propanamide

ID: ALA1091762

PubChem CID: 46884410

Max Phase: Preclinical

Molecular Formula: C27H34N4O2S

Molecular Weight: 478.66

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN[C@@H](C)C(=O)N[C@H](C(=O)N1CCC[C@H]1c1nc(-c2cccc3ccccc23)cs1)C(C)(C)C

Standard InChI:  InChI=1S/C27H34N4O2S/c1-17(28-5)24(32)30-23(27(2,3)4)26(33)31-15-9-14-22(31)25-29-21(16-34-25)20-13-8-11-18-10-6-7-12-19(18)20/h6-8,10-13,16-17,22-23,28H,9,14-15H2,1-5H3,(H,30,32)/t17-,22-,23+/m0/s1

Standard InChI Key:  GYYAJGUBSPVKPD-PDIWNELESA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    5.2240    0.3982    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9394   -0.0124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2240    1.2236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6548    0.3982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9394   -0.8379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3702   -0.0124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6548    1.2236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0856    0.3982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8009   -0.0124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0856    1.2236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8009   -0.8379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5122    0.3982    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2653    0.0647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8190    0.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4082    1.3905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6008    1.2196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4401   -0.7427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8868   -1.3572    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.2974   -2.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1050   -1.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1907   -1.0810    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8035    1.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3711    1.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8150   -2.3152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5290   -1.9080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2426   -2.3219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2404   -3.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5231   -3.5592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8121   -3.1391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0950   -3.5447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0875   -4.3702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8032   -4.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5175   -4.3805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0799    2.0490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 13 17  1  1
 17 18  1  0
  8  9  1  0
  2  5  1  6
  8 10  1  1
  1  3  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 17  2  0
 10 22  1  0
  9 11  2  0
  4  6  1  0
 10 23  1  0
  9 12  1  0
 24 29  2  0
 28 27  2  0
 12 13  1  0
 26 25  2  0
 25 24  1  0
 20 24  1  0
  1  2  1  0
  4  7  2  0
 26 27  1  0
  2  4  1  0
  6  8  1  0
 28 29  1  0
 13 14  1  0
 29 30  1  0
 14 15  1  0
 30 31  2  0
 15 16  1  0
 31 32  1  0
 16 12  1  0
 32 33  2  0
 33 28  1  0
 10 34  1  0
M  END

Associated Targets(Human)

XIAP Tchem Inhibitor of apoptosis protein 3 (3673 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BIRC7 Tchem Baculoviral IAP repeat-containing protein 7 (64 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 478.66Molecular Weight (Monoisotopic): 478.2402AlogP: 4.77#Rotatable Bonds: 6
Polar Surface Area: 74.33Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.50CX Basic pKa: 8.60CX LogP: 4.32CX LogD: 3.09
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.54Np Likeness Score: -0.25

References

1. Cohen F, Koehler MF, Bergeron P, Elliott LO, Flygare JA, Franklin MC, Gazzard L, Keteltas SF, Lau K, Ly CQ, Tsui V, Fairbrother WJ..  (2010)  Antagonists of inhibitor of apoptosis proteins based on thiazole amide isosteres.,  20  (7): [PMID:20189383] [10.1016/j.bmcl.2010.02.021]

Source