N-ethyl-N-(6-methoxypyridin-3-yl)-2-oxo-6-phenyl-1,2-dihydropyridine-3-carboxamide

ID: ALA1091770

PubChem CID: 46883888

Max Phase: Preclinical

Molecular Formula: C20H19N3O3

Molecular Weight: 349.39

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(C(=O)c1ccc(-c2ccccc2)[nH]c1=O)c1ccc(OC)nc1

Standard InChI:  InChI=1S/C20H19N3O3/c1-3-23(15-9-12-18(26-2)21-13-15)20(25)16-10-11-17(22-19(16)24)14-7-5-4-6-8-14/h4-13H,3H2,1-2H3,(H,22,24)

Standard InChI Key:  UIBHNPAXZOZMPF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    5.7494   -4.4540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4654   -4.0402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1818   -4.4470    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4608   -3.2142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1864   -5.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8935   -4.0322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4685   -5.6863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4726   -6.5114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1896   -6.9191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9085   -6.4995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9004   -5.6758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1954   -7.7450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4842   -8.1608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8889   -3.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0359   -4.0412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0449   -5.6932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7578   -5.2772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3233   -5.2861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3208   -4.4602    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0326   -3.2151    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6169   -5.7001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9002   -5.2915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1890   -5.7056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1887   -6.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9152   -6.9390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6230   -6.5224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
 12 13  1  0
  5  7  2  0
  6 14  1  0
  2  4  2  0
  7  8  1  0
  8  9  2  0
  3  5  1  0
  9 10  1  0
  2  3  1  0
 10 11  2  0
 11  5  1  0
  3  6  1  0
  9 12  1  0
  1 15  1  0
 15 19  1  0
 18 16  2  0
 16 17  1  0
 17  1  2  0
 18 19  1  0
 15 20  2  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 18 21  1  0
M  END

Associated Targets(Human)

OXTR Tclin Oxytocin receptor (1962 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 349.39Molecular Weight (Monoisotopic): 349.1426AlogP: 3.11#Rotatable Bonds: 5
Polar Surface Area: 75.29Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.61CX Basic pKa: 1.99CX LogP: 1.78CX LogD: 1.78
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.77Np Likeness Score: -1.86

References

1. Brown A, Ellis D, Wallace O, Ralph M..  (2010)  Identification of amide bioisosteres of triazole oxytocin antagonists.,  20  (7): [PMID:20189387] [10.1016/j.bmcl.2010.02.018]

Source