The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(5-(4-Phenylsulfonylfurazan-3-yloxy)-1-hydroxypentylidene)bis(phosphonic) acid ID: ALA1091856
PubChem CID: 46866079
Product Number: B608917, Order Now?
Max Phase: Preclinical
Molecular Formula: C13H18N2O11P2S
Molecular Weight: 472.31
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=P(O)(O)C(O)(CCCCOc1nonc1S(=O)(=O)c1ccccc1)P(=O)(O)O
Standard InChI: InChI=1S/C13H18N2O11P2S/c16-13(27(17,18)19,28(20,21)22)8-4-5-9-25-11-12(15-26-14-11)29(23,24)10-6-2-1-3-7-10/h1-3,6-7,16H,4-5,8-9H2,(H2,17,18,19)(H2,20,21,22)
Standard InChI Key: PSWFNEHHRVMWEJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
9.9594 -21.7644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6421 -22.2273 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2945 -21.7224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0146 -20.9421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1899 -20.9739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4425 -20.2393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2671 -20.2581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6957 -19.5535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5204 -19.5724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9491 -18.8676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7736 -18.8865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2023 -18.1819 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
15.1696 -19.6101 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
14.7409 -20.3148 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6088 -20.3005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9719 -19.7826 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1554 -17.3568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9301 -18.5585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8907 -17.7305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6824 -20.3237 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.0939 -19.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3140 -18.9282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7264 -18.3381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9198 -18.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7043 -19.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2935 -19.9486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9648 -20.7289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3951 -19.9086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5675 -19.0960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6 7 1 0
13 15 1 0
2 3 1 0
13 16 1 0
7 8 1 0
12 17 1 0
3 4 2 0
12 18 2 0
8 9 1 0
12 19 1 0
4 5 1 0
5 20 1 0
9 10 1 0
20 21 1 0
5 1 2 0
21 22 2 0
10 11 1 0
22 23 1 0
1 2 1 0
23 24 2 0
11 12 1 0
24 25 1 0
4 6 1 0
25 26 2 0
26 21 1 0
11 13 1 0
20 27 2 0
20 28 2 0
13 14 2 0
11 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.31Molecular Weight (Monoisotopic): 472.0107AlogP: 0.45#Rotatable Bonds: 10Polar Surface Area: 217.58Molecular Species: ACIDHBA: 9HBD: 5#RO5 Violations: ┄HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 0.69CX Basic pKa: ┄CX LogP: -0.14CX LogD: -5.07Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.23Np Likeness Score: -0.72
References 1. Lolli ML, Rolando B, Tosco P, Chaurasia S, Di Stilo A, Lazzarato L, Gorassini E, Ferracini R, Oliaro-Bosso S, Fruttero R, Gasco A.. (2010) Synthesis and preliminary pharmacological characterisation of a new class of nitrogen-containing bisphosphonates (N-BPs)., 18 (7): [PMID:20299227 ] [10.1016/j.bmc.2010.02.058 ]