N-(biphenyl-4-ylmethyl)-N-(2-chloro-4-fluorobenzyl)benzamide

ID: ALA1091958

PubChem CID: 46202928

Max Phase: Preclinical

Molecular Formula: C27H21ClFNO

Molecular Weight: 429.92

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(c1ccccc1)N(Cc1ccc(-c2ccccc2)cc1)Cc1ccc(F)cc1Cl

Standard InChI:  InChI=1S/C27H21ClFNO/c28-26-17-25(29)16-15-24(26)19-30(27(31)23-9-5-2-6-10-23)18-20-11-13-22(14-12-20)21-7-3-1-4-8-21/h1-17H,18-19H2

Standard InChI Key:  SISXRZFAYYJKHJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   21.2665   -8.0724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2652   -8.9016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9769   -9.3152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6952   -8.9010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6919   -8.0682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9749   -7.6635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4019   -7.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1209   -8.0628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8345   -7.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8306   -6.8215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1069   -6.4099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3962   -6.8310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5441   -6.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2633   -6.8119    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.9769   -6.3915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9714   -5.5651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6834   -5.1532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6783   -4.3274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9633   -3.9158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2473   -4.3406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2559   -5.1649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2669   -7.6401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9811   -8.0466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9811   -8.8700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6898   -9.2812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4022   -8.8652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3969   -8.0386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6829   -7.6359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4013   -5.5615    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   26.9566   -3.0893    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   25.5521   -8.0537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 14 15  1  0
  7  8  2  0
 15 16  1  0
 16 17  2  0
  8  9  1  0
 17 18  1  0
  4  5  1  0
 18 19  2  0
  9 10  2  0
 19 20  1  0
  2  3  1  0
 20 21  2  0
 21 16  1  0
 10 11  1  0
 14 22  1  0
  5  6  2  0
 22 23  1  0
 11 12  2  0
 23 24  2  0
 12  7  1  0
 24 25  1  0
  5  7  1  0
 25 26  2  0
  6  1  1  0
 26 27  1  0
 10 13  1  0
 27 28  2  0
 28 23  1  0
  1  2  2  0
 17 29  1  0
 13 14  1  0
 19 30  1  0
  3  4  2  0
 22 31  2  0
M  END

Associated Targets(Human)

NR1H2 Tchem LXR-beta (3841 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 429.92Molecular Weight (Monoisotopic): 429.1296AlogP: 6.99#Rotatable Bonds: 6
Polar Surface Area: 20.31Molecular Species: NEUTRALHBA: 1HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 7.11CX LogD: 7.11
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.32Np Likeness Score: -1.44

References

1. Zuercher WJ, Buckholz RG, Campobasso N, Collins JL, Galardi CM, Gampe RT, Hyatt SM, Merrihew SL, Moore JT, Oplinger JA, Reid PR, Spearing PK, Stanley TB, Stewart EL, Willson TM..  (2010)  Discovery of tertiary sulfonamides as potent liver X receptor antagonists.,  53  (8): [PMID:20345102] [10.1021/jm901797p]

Source