2-(2,4-dichlorophenyl)-4-(pyridin-3-ylmethylene)oxazol-5(4H)-one

ID: ALA1092140

PubChem CID: 5374372

Max Phase: Preclinical

Molecular Formula: C15H8Cl2N2O2

Molecular Weight: 319.15

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1OC(c2ccc(Cl)cc2Cl)=N/C1=C\c1cccnc1

Standard InChI:  InChI=1S/C15H8Cl2N2O2/c16-10-3-4-11(12(17)7-10)14-19-13(15(20)21-14)6-9-2-1-5-18-8-9/h1-8H/b13-6-

Standard InChI Key:  SRHIORVHIQERHE-MLPAPPSSSA-N

Molfile:  

     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   -3.5916   -9.6127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6263  -10.4393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9288  -10.8808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1962  -10.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1654   -9.6668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8636   -9.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8327   -8.4047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1033   -8.0192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4315   -8.5048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7658   -8.0127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0268   -7.2327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8518   -7.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3396   -6.5725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0554   -8.0180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4615   -8.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2857   -8.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7048   -8.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2937   -7.3127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4708   -7.3092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0424   -9.4481    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.5298   -8.0385    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  5  6  2  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12  8  1  0
  6  1  1  0
 12 13  2  0
  1  2  2  0
  6  7  1  0
 14 15  2  0
  3  4  2  0
 15 16  1  0
  7  8  2  0
 16 17  2  0
  8  9  1  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 10 14  1  0
  4  5  1  0
 15 20  1  0
  2  3  1  0
 17 21  1  0
M  END

Associated Targets(Human)

DAPK3 Tchem Death-associated protein kinase 3 (2108 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 319.15Molecular Weight (Monoisotopic): 317.9963AlogP: 3.73#Rotatable Bonds: 2
Polar Surface Area: 51.55Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.68CX LogP: 3.83CX LogD: 3.83
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.63Np Likeness Score: -1.59

References

1. Okamoto M, Takayama K, Shimizu T, Muroya A, Furuya T..  (2010)  Structure-activity relationship of novel DAPK inhibitors identified by structure-based virtual screening.,  18  (7): [PMID:20206532] [10.1016/j.bmc.2010.02.018]

Source