5-[((3-Amino-3-carboxy)propyl)(hydroxy)phosphinyl]pentanoic acid

ID: ALA1092242

PubChem CID: 24779946

Max Phase: Preclinical

Molecular Formula: C9H18NO6P

Molecular Weight: 267.22

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(CCP(=O)(O)CCCCC(=O)O)C(=O)O

Standard InChI:  InChI=1S/C9H18NO6P/c10-7(9(13)14)4-6-17(15,16)5-2-1-3-8(11)12/h7H,1-6,10H2,(H,11,12)(H,13,14)(H,15,16)

Standard InChI Key:  PCADKDQIEORBCP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 17 16  0  0  0  0  0  0  0  0999 V2000
   -3.5934  -10.6152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8789  -10.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1644  -10.6152    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4499  -10.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1644  -11.4403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1725   -9.7856    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7355  -10.6152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0210  -10.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3079  -10.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0224  -10.6152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3079   -9.3777    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7368  -10.2027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0224  -11.4403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6935  -10.6152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4080  -10.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1225  -10.6152    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4080   -9.3777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  9  1  0
  3  5  1  0
  9 10  1  0
  2  3  1  0
  9 11  1  0
  3  6  2  0
 10 12  1  0
  1  2  1  0
 10 13  2  0
  4  7  1  0
  8 14  1  0
  3  4  1  0
 14 15  1  0
  7  8  1  0
 15 16  1  0
 15 17  2  0
M  END

Associated Targets(non-human)

Grm4 Metabotropic glutamate receptor 4 (663 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 267.22Molecular Weight (Monoisotopic): 267.0872AlogP: 0.31#Rotatable Bonds: 9
Polar Surface Area: 137.92Molecular Species: ZWITTERIONHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 1.82CX Basic pKa: 9.53CX LogP: -2.89CX LogD: -8.78
Aromatic Rings: Heavy Atoms: 17QED Weighted: 0.35Np Likeness Score: 0.89

References

1. Selvam C, Oueslati N, Lemasson IA, Brabet I, Rigault D, Courtiol T, Cesarini S, Triballeau N, Bertrand HO, Goudet C, Pin JP, Acher FC..  (2010)  A virtual screening hit reveals new possibilities for developing group III metabotropic glutamate receptor agonists.,  53  (7): [PMID:20218620] [10.1021/jm901523t]

Source