(3S)-2-[((3-Amino-3-carboxy)propyl)(hydroxy)phosphinyl]-ethylphosphonate

ID: ALA1092244

Max Phase: Preclinical

Molecular Formula: C6H15NO7P2

Molecular Weight: 275.13

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N[C@@H](CCP(=O)(O)CCP(=O)(O)O)C(=O)O

Standard InChI:  InChI=1S/C6H15NO7P2/c7-5(6(8)9)1-2-15(10,11)3-4-16(12,13)14/h5H,1-4,7H2,(H,8,9)(H,10,11)(H2,12,13,14)/t5-/m0/s1

Standard InChI Key:  VWCVVQHTGLXCCJ-YFKPBYRVSA-N

Molfile:  

     RDKit          2D

 16 15  0  0  0  0  0  0  0  0999 V2000
   14.1262  -10.9911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8406  -10.5786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5551  -10.9911    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   16.2696  -10.5786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5551  -11.8161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5470  -10.1615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9840  -10.9911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6986  -10.5786    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   13.4116  -10.5786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6971  -10.9911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4116   -9.7536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9827  -10.5786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6971  -11.8161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4131  -10.9911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6986   -9.7536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6920  -11.3990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  9  1  0
  3  5  1  0
  9 10  1  0
  2  3  1  0
  9 11  1  1
  3  6  2  0
 10 12  1  0
  1  2  1  0
 10 13  2  0
  4  7  1  0
  8 14  1  0
  3  4  1  0
  8 15  2  0
  7  8  1  0
  8 16  1  0
M  END

Alternative Forms

  1. Parent:

    ALA1092244

    ---

Associated Targets(non-human)

Grm4 Metabotropic glutamate receptor 4 (663 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Grm8 Metabotropic glutamate receptor 8 (169 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 275.13Molecular Weight (Monoisotopic): 275.0324AlogP: -0.76#Rotatable Bonds: 7
Polar Surface Area: 158.15Molecular Species: ZWITTERIONHBA: 4HBD: 5
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 1.46CX Basic pKa: 9.56CX LogP: -4.70CX LogD: -10.25
Aromatic Rings: Heavy Atoms: 16QED Weighted: 0.38Np Likeness Score: 0.78

References

1. Selvam C, Oueslati N, Lemasson IA, Brabet I, Rigault D, Courtiol T, Cesarini S, Triballeau N, Bertrand HO, Goudet C, Pin JP, Acher FC..  (2010)  A virtual screening hit reveals new possibilities for developing group III metabotropic glutamate receptor agonists.,  53  (7): [PMID:20218620] [10.1021/jm901523t]

Source