The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-4-(4'-benzylthio-3-chlorobiphenyl-4-yl)-2-(phosphoryloxymethyl)butanol ID: ALA1092285
Max Phase: Preclinical
Molecular Formula: C25H29ClNO4PS
Molecular Weight: 506.00
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=P(O)(O)OCC(N)(CO)CCc1ccc(-c2ccc(SCc3ccccc3)cc2)cc1Cl
Standard InChI: InChI=1S/C25H29ClNO4PS/c1-32(29,30)31-18-25(27,17-28)14-13-21-7-8-22(15-24(21)26)20-9-11-23(12-10-20)33-16-19-5-3-2-4-6-19/h2-12,15,28-30H,1,13-14,16-18,27H2
Standard InChI Key: WEYWOPITACEWLF-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
-4.3844 -0.3825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5594 -0.3825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5594 -1.2075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7969 0.3320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2738 -1.6200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7344 -0.3825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3219 -1.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1531 -1.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2594 -1.8114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0844 -1.8114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4969 -1.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0844 -0.3825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2594 -0.3825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9781 -1.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3906 -0.3825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2156 -0.3825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6281 -1.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2156 -1.8114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3906 -1.8114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4969 -2.5259 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.4531 -1.0970 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.8656 -1.8114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6906 -1.8114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1031 -1.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9281 -1.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3406 -1.8114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9281 -2.5259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1031 -2.5259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5594 0.4425 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2738 -2.4449 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
-4.2792 -3.2625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4562 -2.4476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.0914 -2.4422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 5 1 0
6 7 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
8 13 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
14 19 2 0
8 14 1 0
10 20 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
23 28 2 0
21 22 1 0
17 21 1 0
7 11 1 0
2 6 1 0
2 29 1 0
5 30 1 0
1 2 1 0
30 31 1 0
2 3 1 0
30 32 1 0
1 4 1 0
30 33 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.00Molecular Weight (Monoisotopic): 505.1243AlogP: 5.12#Rotatable Bonds: 11Polar Surface Area: 95.94Molecular Species: ZWITTERIONHBA: 6HBD: 4#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.69CX Basic pKa: 9.16CX LogP: 3.90CX LogD: 3.64Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.21Np Likeness Score: -0.30
References 1. Hamada M, Nakamura M, Kiuchi M, Marukawa K, Tomatsu A, Shimano K, Sato N, Sugahara K, Asayama M, Takagi K, Adachi K.. (2010) Removal of sphingosine 1-phosphate receptor-3 (S1P(3)) agonism is essential, but inadequate to obtain immunomodulating 2-aminopropane-1,3-diol S1P(1) agonists with reduced effect on heart rate., 53 (8): [PMID:20337461 ] [10.1021/jm901776q ]