2-Amino-4-(4'-benzylthio-3-chlorobiphenyl-4-yl)-2-(phosphoryloxymethyl)butanol

ID: ALA1092285

Max Phase: Preclinical

Molecular Formula: C25H29ClNO4PS

Molecular Weight: 506.00

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=P(O)(O)OCC(N)(CO)CCc1ccc(-c2ccc(SCc3ccccc3)cc2)cc1Cl

Standard InChI:  InChI=1S/C25H29ClNO4PS/c1-32(29,30)31-18-25(27,17-28)14-13-21-7-8-22(15-24(21)26)20-9-11-23(12-10-20)33-16-19-5-3-2-4-6-19/h2-12,15,28-30H,1,13-14,16-18,27H2

Standard InChI Key:  WEYWOPITACEWLF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   -4.3844   -0.3825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5594   -0.3825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5594   -1.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7969    0.3320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2738   -1.6200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7344   -0.3825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3219   -1.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1531   -1.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2594   -1.8114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0844   -1.8114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4969   -1.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0844   -0.3825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2594   -0.3825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9781   -1.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3906   -0.3825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2156   -0.3825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6281   -1.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2156   -1.8114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3906   -1.8114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4969   -2.5259    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.4531   -1.0970    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.8656   -1.8114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6906   -1.8114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1031   -1.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9281   -1.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3406   -1.8114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9281   -2.5259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1031   -2.5259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5594    0.4425    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2738   -2.4449    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2792   -3.2625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4562   -2.4476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0914   -2.4422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  5  1  0
  6  7  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
  8 13  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 14 19  2  0
  8 14  1  0
 10 20  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 23 28  2  0
 21 22  1  0
 17 21  1  0
  7 11  1  0
  2  6  1  0
  2 29  1  0
  5 30  1  0
  1  2  1  0
 30 31  1  0
  2  3  1  0
 30 32  1  0
  1  4  1  0
 30 33  2  0
M  END

Alternative Forms

  1. Parent:

    ALA1092285

    ---

Associated Targets(Human)

S1PR1 Tclin Sphingosine 1-phosphate receptor Edg-1 (5806 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
S1PR3 Tclin Sphingosine 1-phosphate receptor Edg-3 (2543 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.00Molecular Weight (Monoisotopic): 505.1243AlogP: 5.12#Rotatable Bonds: 11
Polar Surface Area: 95.94Molecular Species: ZWITTERIONHBA: 6HBD: 4
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 1.69CX Basic pKa: 9.16CX LogP: 3.90CX LogD: 3.64
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.21Np Likeness Score: -0.30

References

1. Hamada M, Nakamura M, Kiuchi M, Marukawa K, Tomatsu A, Shimano K, Sato N, Sugahara K, Asayama M, Takagi K, Adachi K..  (2010)  Removal of sphingosine 1-phosphate receptor-3 (S1P(3)) agonism is essential, but inadequate to obtain immunomodulating 2-aminopropane-1,3-diol S1P(1) agonists with reduced effect on heart rate.,  53  (8): [PMID:20337461] [10.1021/jm901776q]

Source