(3S)-3-[((3-Amino-3-carboxylate)propyl)(hydroxy)phosphinate]-3-hydroxymethylpropanoate

ID: ALA1092313

PubChem CID: 46197782

Max Phase: Preclinical

Molecular Formula: C8H16NO7P

Molecular Weight: 269.19

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N[C@@H](CCP(=O)(O)C(CO)CC(=O)O)C(=O)O

Standard InChI:  InChI=1S/C8H16NO7P/c9-6(8(13)14)1-2-17(15,16)5(4-10)3-7(11)12/h5-6,10H,1-4,9H2,(H,11,12)(H,13,14)(H,15,16)/t5?,6-/m0/s1

Standard InChI Key:  CLUHLHVRNKPCNZ-GDVGLLTNSA-N

Molfile:  

     RDKit          2D

 17 16  0  0  0  0  0  0  0  0999 V2000
    5.1289  -23.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8433  -22.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5578  -23.2518    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    7.2724  -22.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5578  -24.0768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5498  -22.4221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4144  -22.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6999  -23.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9854  -22.8393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6999  -24.0768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4144  -22.0142    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9868  -23.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7013  -22.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4158  -23.2518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7013  -22.0142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2724  -22.0142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9868  -21.6017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  8  9  1  0
  3  5  1  0
  8 10  2  0
  2  3  1  0
  7 11  1  1
  3  6  2  0
  4 12  1  0
  1  2  1  0
 12 13  1  0
  1  7  1  0
 13 14  1  0
  3  4  1  0
 13 15  2  0
  7  8  1  0
  4 16  1  0
 16 17  1  0
M  END

Associated Targets(non-human)

Grm4 Metabotropic glutamate receptor 4 (663 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 269.19Molecular Weight (Monoisotopic): 269.0664AlogP: -1.11#Rotatable Bonds: 8
Polar Surface Area: 158.15Molecular Species: ZWITTERIONHBA: 5HBD: 5
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 1.59CX Basic pKa: 9.53CX LogP: -4.16CX LogD: -10.17
Aromatic Rings: Heavy Atoms: 17QED Weighted: 0.35Np Likeness Score: 0.99

References

1. Selvam C, Oueslati N, Lemasson IA, Brabet I, Rigault D, Courtiol T, Cesarini S, Triballeau N, Bertrand HO, Goudet C, Pin JP, Acher FC..  (2010)  A virtual screening hit reveals new possibilities for developing group III metabotropic glutamate receptor agonists.,  53  (7): [PMID:20218620] [10.1021/jm901523t]

Source